![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 70485 - Coupa ENT FRANCE.pdf | 2024-12-19 11:45 | 0 | |
![[ ]](/icons/layout.gif) | 75507アナリストレポート_VMwareのお客様が代替案を評価.pdf | 2026-01-16 11:26 | 0 | |
![[ ]](/icons/layout.gif) | 75507ハイブリッドクラウドバックアップの達人になる_セキュアソリューションebook.pdf | 2026-01-16 11:25 | 0 | |
![[TXT]](/icons/text.gif) | 104131 - 34-33- 104078 Lenovo APAC.html | 2025-05-22 14:06 | 8.7K | |
![[TXT]](/icons/text.gif) | 9505B3 - Lenovo (1).html | 2025-05-22 14:05 | 13K | |
![[ ]](/icons/layout.gif) | 73119Asset_Matrix_06122025.pdf | 2025-06-24 10:05 | 20K | |
![[TXT]](/icons/text.gif) | Nutanix - 1 (1).html | 2025-05-22 12:57 | 20K | |
![[ ]](/icons/layout.gif) | Boost your content workflows with Creative Cloud for enterprise.pdf | 2025-08-05 08:20 | 20K | |
![[TXT]](/icons/text.gif) | Nutanix - 2 (1).html | 2025-05-22 12:57 | 21K | |
![[ ]](/icons/layout.gif) | Boost conversions by optimizing the checkout experience with Payment Services.pdf | 2025-11-14 10:18 | 21K | |
![[ ]](/icons/layout.gif) | Boost Creative Capacity with BrandTrained AI.pdf | 2026-01-23 11:22 | 21K | |
![[ ]](/icons/layout.gif) | Asset_Matrix_07222025.pdf | 2025-09-03 09:04 | 21K | |
![[TXT]](/icons/text.gif) | Cohesity C-4.html | 2025-05-22 14:51 | 21K | |
![[ ]](/icons/layout.gif) | The Business Impact of Adobe Creative Solutions.pdf | 2026-01-05 10:27 | 21K | |
![[TXT]](/icons/text.gif) | Cohesity C-2.html | 2025-05-22 14:51 | 21K | |
![[TXT]](/icons/text.gif) | Cohesity C-5.html | 2025-05-22 14:51 | 21K | |
![[TXT]](/icons/text.gif) | Cohesity C-7.html | 2025-05-22 14:51 | 21K | |
![[TXT]](/icons/text.gif) | Cohesity C-3.html | 2025-05-22 14:51 | 21K | |
![[TXT]](/icons/text.gif) | Cohesity C-6.html | 2025-05-22 14:51 | 21K | |
![[ ]](/icons/layout.gif) | 73853AssetMatrix08192025.pdf | 2025-09-18 13:50 | 21K | |
![[TXT]](/icons/text.gif) | Cohesity C-1.html | 2025-05-22 14:51 | 21K | |
![[TXT]](/icons/text.gif) | Nutanix - 3 (1).html | 2025-05-22 12:57 | 23K | |
![[ ]](/icons/layout.gif) | Retail Leaders AIDriven Growth Top Performer Playbooks.pdf | 2025-10-06 12:21 | 23K | |
![[TXT]](/icons/text.gif) | Terra Helix.html | 2025-05-22 14:01 | 28K | |
![[ ]](/icons/layout.gif) | 73690Asset_Matrix_08112025.pdf | 2025-09-03 09:27 | 28K | |
![[ ]](/icons/layout.gif) | 7548175199_Amplifying_Human_Potential_with_AI.pdf | 2026-01-30 10:30 | 29K | |
![[ ]](/icons/layout.gif) | Asset_Matrix.pdf | 2025-11-19 11:48 | 31K | |
![[ ]](/icons/layout.gif) | 74563Asset_Matrix_08192025.pdf | 2025-11-05 09:40 | 34K | |
![[ ]](/icons/layout.gif) | 73061Confluent__Thao____Q2_2025___PSA___assets.pdf | 2025-06-27 10:59 | 35K | |
![[ ]](/icons/layout.gif) | 147086_20250207MADirectmailerUpdating Gambling Brochure_twopager_A4.pdf | 2025-06-09 05:36 | 44K | |
![[ ]](/icons/layout.gif) | 71023GHGSat_O_G_From_Days_to_Hours_How_GHGSat_is_Innovating_Emissions_Management_Using_AI.pdf | 2025-03-28 12:21 | 59K | |
![[ ]](/icons/layout.gif) | 75083asset_matrix.pdf | 2025-12-03 10:49 | 61K | |
![[ ]](/icons/layout.gif) | cr-wp-top-ten-actions-during-ransomware-attack.pdf | 2025-06-09 12:59 | 70K | |
![[ ]](/icons/layout.gif) | 148933_whitepaperguidetobalancinginnovationandstability.pdf | 2026-01-28 13:47 | 70K | |
![[ ]](/icons/layout.gif) | 73390Asset_Matrix___07082025.pdf | 2025-07-14 07:35 | 79K | |
![[ ]](/icons/layout.gif) | 74260Infographic_Global_Survey_of_Data_Center_experts.pdf | 2025-11-10 11:14 | 92K | |
![[ ]](/icons/layout.gif) | What is Cloud Telephony-compressed.pdf | 2025-07-25 08:46 | 113K | |
![[ ]](/icons/layout.gif) | What is Cloud Telephony-compressed (1).pdf | 2025-08-21 16:34 | 113K | |
![[ ]](/icons/layout.gif) | Operationalize your AI models_4 key elements.pdf | 2024-11-19 10:10 | 114K | |
![[ ]](/icons/layout.gif) | How Wi-Fi 6, WWAN and 5G Make All-Wireless Offices Possible-compressed.pdf | 2025-07-18 08:39 | 121K | |
![[ ]](/icons/layout.gif) | 138838_Oxford Executive SummaryCFO InsightsAdapting the Role of Finance.pdf | 2025-03-12 13:53 | 126K | |
![[ ]](/icons/layout.gif) | Why Laptops and Other Edge Devices Are Being AI-enabled-compressed.pdf | 2025-07-16 08:07 | 128K | |
![[ ]](/icons/layout.gif) | Boost Your Customers Buying Power with Flexible Financing.pdf | 2025-11-13 10:01 | 130K | |
![[ ]](/icons/layout.gif) | APAC-SOCI Compliance Mapping.pdf | 2025-07-17 09:00 | 132K | |
![[ ]](/icons/layout.gif) | How SD-WAN for Home Offices Supports Remote Work-compressed.pdf | 2025-07-14 11:33 | 133K | |
![[ ]](/icons/layout.gif) | pa-aws-managed-openshift-brief-265150pr-202303-en.pdf | 2025-05-22 12:22 | 140K | |
![[ ]](/icons/layout.gif) | Archer_NextGenRMIS_whitepaper_June2024.pdf | 2025-01-22 17:02 | 145K | |
![[ ]](/icons/layout.gif) | FY25-7694-LEGACY-VDI-IFG-USWEB-20250228.pdf | 2025-05-07 09:06 | 166K | |
![[ ]](/icons/layout.gif) | Active Directory Security Checklist.pdf | 2024-12-18 13:24 | 168K | |
![[ ]](/icons/layout.gif) | 73927AI_Powering_smart_solutions_in_an_ever_changing_world.pdf | 2025-08-14 09:13 | 177K | |
![[ ]](/icons/layout.gif) | 144878_Slack Named a Worldwide Leader by 2024 IDC MarketSc (1).pdf | 2025-03-07 12:31 | 180K | |
![[ ]](/icons/layout.gif) | 144878_Slack Named a Worldwide Leader by 2024 IDC MarketScape for Team Collaboration.pdf | 2025-07-14 13:59 | 180K | |
![[ ]](/icons/layout.gif) | 73064broadband_for_internet_and_regional_service_providers_an.pdf | 2025-10-09 12:25 | 195K | |
![[ ]](/icons/layout.gif) | APAC NTT DATA_Carrefour takes a cloud first approach to their digital transformation.pdf | 2025-12-02 09:56 | 201K | |
![[ ]](/icons/layout.gif) | 5 Predictions About 5G Adoption in 2024 and Beyond-compressed.pdf | 2025-07-14 12:04 | 206K | |
![[ ]](/icons/layout.gif) | How Agent Assist Technology Works in the Contact Center.pdf | 2025-01-31 10:45 | 216K | |
![[IMG]](/icons/image2.gif) | Untitled.png | 2024-12-12 10:40 | 221K | |
![[ ]](/icons/layout.gif) | Are Wireless Networks More Energy-Efficient Than Wired LANs.pdf | 2025-07-18 08:25 | 222K | |
![[ ]](/icons/layout.gif) | Payroll Systems Migrations Lead to Errors and Anger.pdf | 2025-12-09 15:12 | 222K | |
![[ ]](/icons/layout.gif) | Enterprise Hybrid AI Use is Poised to Grow.pdf | 2025-07-23 08:46 | 223K | |
![[ ]](/icons/layout.gif) | How AI Affects Low-Code No-Code for DevOps 2.pdf | 2025-04-09 11:14 | 229K | |
![[ ]](/icons/layout.gif) | How Contact Center Modernization Plays Into AI Strategies.pdf | 2025-09-26 17:14 | 229K | |
![[ ]](/icons/layout.gif) | 7 Benefits of Payroll Automation.pdf | 2025-12-09 15:09 | 231K | |
![[ ]](/icons/layout.gif) | SN + Nexon - eb-genai-guide-compressed.pdf | 2025-08-28 09:04 | 234K | |
![[ ]](/icons/layout.gif) | The Status of the US 5G Fixed Wireless Access Market.pdf | 2025-09-30 08:21 | 239K | |
![[ ]](/icons/layout.gif) | 8 Vulnerability Management Tools to Consider in 2023.pdf | 2025-12-17 09:36 | 240K | |
![[ ]](/icons/layout.gif) | Companies Reassess Generative AI in Supply Chain Tech.pdf | 2025-07-16 14:38 | 242K | |
![[ ]](/icons/layout.gif) | How Wi-Fi 6, WWAN and 5G Make All-Wireless Offices Possible.pdf | 2025-01-31 16:37 | 247K | |
![[ ]](/icons/layout.gif) | 11 More Alternative Desktop and App Virtualization Vendors.pdf | 2025-09-26 17:24 | 250K | |
![[ ]](/icons/layout.gif) | Private LTE Networks Grow as 5G Comes into View.pdf | 2025-07-21 09:46 | 254K | |
![[ ]](/icons/layout.gif) | Criteria for choosing an outsourced cloud ERP IT help desk.pdf | 2025-03-06 12:50 | 256K | |
![[ ]](/icons/layout.gif) | 74627boost_revenue_smarter_cx.pdf | 2025-12-05 11:02 | 256K | |
![[ ]](/icons/layout.gif) | esg-securing-the-endpoint-security-brief EN.pdf | 2025-08-22 14:31 | 257K | |
![[ ]](/icons/layout.gif) | 144757_How Workforce Identity can power security_de.pdf | 2025-03-27 12:26 | 258K | |
![[ ]](/icons/layout.gif) | UCaaS vs VoIP Whats the Difference.pdf | 2025-07-25 08:39 | 260K | |
![[ ]](/icons/layout.gif) | VoIP Codecs Explained How to Optimize VoIP Quality.pdf | 2025-09-26 17:29 | 263K | |
![[ ]](/icons/layout.gif) | Security Think Tank - Adopt a Coherent Framework for ID First Security.pdf | 2025-12-17 09:27 | 270K | |
![[ ]](/icons/layout.gif) | Why Laptops and Other Edge Devices Are Being AI-enabled.pdf | 2025-01-07 14:17 | 270K | |
![[ ]](/icons/layout.gif) | Top 4 Unified Endpoint Management Software Vendors in 2024 (1).pdf | 2025-07-14 12:10 | 274K | |
![[ ]](/icons/layout.gif) | VMware Alternatives Increase but Moving Wont Be Easy.pdf | 2025-11-10 10:29 | 275K | |
![[ ]](/icons/layout.gif) | Augmented Reality vs Virtual Reality vs Mixed Reality.pdf | 2025-07-14 12:26 | 277K | |
![[ ]](/icons/layout.gif) | 145154_DC Modern Workplace EN_UK.pdf | 2025-03-26 07:11 | 278K | |
![[ ]](/icons/layout.gif) | Connected Workspace Apps Improve Collaboration Management.pdf | 2025-09-29 11:55 | 279K | |
![[ ]](/icons/layout.gif) | What is Cloud Telephony.pdf | 2025-01-31 10:56 | 279K | |
![[ ]](/icons/layout.gif) | FWA Use Cases for Next-Generation Connectivity.pdf | 2025-09-26 17:43 | 282K | |
![[ ]](/icons/layout.gif) | The Tradeoffs of Partnering with Managed Mobility Services Providers.pdf | 2025-08-21 14:30 | 283K | |
![[ ]](/icons/layout.gif) | Dell Technologies, A Strategic Advisor for Emerging Business.pdf | 2025-12-08 08:02 | 283K | |
![[ ]](/icons/layout.gif) | AMD-How to Sell HP ZBook Ultra G1a.pdf | 2025-07-17 08:16 | 286K | |
![[ ]](/icons/layout.gif) | 144657_10tenetssase.pdf | 2025-06-16 12:14 | 287K | |
![[ ]](/icons/layout.gif) | How to Create a Mobile Device Security Policy With Template.pdf | 2025-07-14 12:18 | 289K | |
![[ ]](/icons/layout.gif) | Top 12 IoT Applications and Examples in Business.pdf | 2025-07-23 08:55 | 289K | |
![[ ]](/icons/layout.gif) | 148876_esg-securing-the-endpoint-security-brief-DE.pdf | 2025-09-02 05:51 | 291K | |
![[ ]](/icons/layout.gif) | 148873_esg-why-ai-pcs-are-top-of-mind-for-end-users-and-itdms-whitepaper.pdf-FR.pdf | 2025-09-02 06:04 | 297K | |
![[ ]](/icons/layout.gif) | 142068_9982095060214AR0_EN 1.pdf | 2024-11-26 16:13 | 297K | |
![[ ]](/icons/layout.gif) | AI Cloud Trends Shape Next-Gen Managed Services Offerings.pdf | 2025-11-10 10:17 | 299K | |
![[ ]](/icons/layout.gif) | 3 Components to Consider When Selecting an MDR Service (2).pdf | 2025-11-04 18:47 | 301K | |
![[ ]](/icons/layout.gif) | Data-and-Omnichannel.pdf | 2024-12-03 14:39 | 302K | |
![[ ]](/icons/layout.gif) | Amazon Business MIT Executive Interview_es-ES.pdf | 2025-10-10 15:03 | 305K | |
![[ ]](/icons/layout.gif) | sustainability brochure_compressed.pdf | 2025-04-25 06:39 | 307K | |
![[ ]](/icons/layout.gif) | Ponemon Report_Key Security Insights_2025.pdf | 2025-09-22 17:58 | 309K | |
![[ ]](/icons/layout.gif) | AMD_HP Elitebook X G1a - How to Sell-HR.pdf | 2025-09-23 18:09 | 315K | |
![[ ]](/icons/layout.gif) | chrome_enterprise_seb_one_pager.pdf | 2025-08-25 10:40 | 321K | |
![[ ]](/icons/layout.gif) | Why You Can Benefit From Using Always On VPN.pdf | 2025-09-30 08:05 | 321K | |
![[ ]](/icons/layout.gif) | 72189AI_at_Work_Unlocking_Global_Opportunities.pdf | 2025-04-14 09:56 | 339K | |
![[ ]](/icons/layout.gif) | 74697AI_at_Work_Unlocking_Global_Opportunities__1_.pdf | 2025-11-04 13:05 | 339K | |
![[ ]](/icons/layout.gif) | 5 Predictions About 5G Adoption in 2024 and Beyond.pdf | 2025-01-31 16:30 | 345K | |
![[ ]](/icons/layout.gif) | 145136_EY_GenAI_Guide_2024_uken.pdf | 2025-05-13 10:57 | 350K | |
![[ ]](/icons/layout.gif) | 71055TAC_900_025_GBL_ART_Drive_industrial_machinery_from_design_to_production.pdf | 2025-03-10 10:44 | 350K | |
![[ ]](/icons/layout.gif) | 149770_ebook_CISOcloudsecurity 1-compressed.pdf | 2025-10-16 08:21 | 352K | |
![[ ]](/icons/layout.gif) | 139799_AComprehensive GuideforYourCustomerIdentityMaturityJourney_102023.pdf | 2025-01-02 07:40 | 360K | |
![[ ]](/icons/layout.gif) | 145369_DCP 1 pager.pdf | 2025-05-13 07:53 | 365K | |
![[ ]](/icons/layout.gif) | 141412_TFE_Library_Infographic.pdf | 2025-12-12 12:49 | 370K | |
![[ ]](/icons/layout.gif) | 151096_strata_networksecuritybuyersguide (1).pdf | 2025-12-22 11:12 | 371K | |
![[ ]](/icons/layout.gif) | 69833FY24_1407_Qualcomm_Vision_AI_Dev_Board_Product_Brief_r5__2_.pdf | 2024-11-06 14:39 | 372K | |
![[ ]](/icons/layout.gif) | 71828practical_AI_infographic_Infographic_Boomi_Enables_Practical_AI.pdf | 2025-04-16 10:52 | 376K | |
![[ ]](/icons/layout.gif) | 145128_thedefinitiveguidetocreatingaunifiedcustomerview.pdf | 2025-05-13 10:50 | 381K | |
![[ ]](/icons/layout.gif) | Schwabisch Hall DE.pdf | 2025-06-04 11:34 | 382K | |
![[ ]](/icons/layout.gif) | Aptean-Industrial-Manufacturing-ERP-Discrete-Manufacturers-Buyers-Guide-en (1).pdf | 2024-11-21 07:53 | 390K | |
![[ ]](/icons/layout.gif) | 69906CRO__1_.pdf | 2024-11-21 09:27 | 407K | |
![[ ]](/icons/layout.gif) | Google Clouds Product Vision for AIPowered Security-compressed.pdf | 2025-05-22 11:43 | 408K | |
![[ ]](/icons/layout.gif) | 142884_Okta_Asset1_Whitepaper_v1.pdf | 2025-01-02 09:31 | 409K | |
![[ ]](/icons/layout.gif) | 142885_Okta_Asset1_Whitepaper_v1.pdf | 2025-01-02 09:40 | 409K | |
![[ ]](/icons/layout.gif) | A Requirementsdriven Approach to Cyber Threat Intelligence.pdf | 2025-07-28 11:21 | 418K | |
![[ ]](/icons/layout.gif) | 736341Legit_AI_security_survey_final.pdf | 2025-08-11 11:39 | 418K | |
![[ ]](/icons/layout.gif) | 142869_it.pdf | 2024-11-28 08:57 | 426K | |
![[ ]](/icons/layout.gif) | Infographic - Cloaked_case_study infographic.pdf | 2025-09-26 11:20 | 436K | |
![[ ]](/icons/layout.gif) | 133704_EcommerceMigration.pdf | 2024-11-20 07:47 | 445K | |
![[ ]](/icons/layout.gif) | 70941Communication_Compliance_in_the_Finance_Industry.pdf | 2025-01-28 08:09 | 464K | |
![[ ]](/icons/layout.gif) | amazon-business-mit-executive-interview UK.pdf | 2025-10-10 15:09 | 472K | |
![[ ]](/icons/layout.gif) | 18 Must-Have HR Software Features and System Requirements.pdf | 2025-12-09 15:06 | 474K | |
![[ ]](/icons/layout.gif) | 6G-Deep-Dive.pdf | 2025-09-29 12:13 | 475K | |
![[ ]](/icons/layout.gif) | 147661_omdia-ai-agents-thought-leadership.pdf | 2025-07-29 08:02 | 477K | |
![[ ]](/icons/layout.gif) | omdia-ai-agents-thought-leadership.pdf | 2025-09-05 12:23 | 477K | |
![[ ]](/icons/layout.gif) | ai-sweden-case-study-0824.pdf | 2025-09-10 10:05 | 481K | |
![[ ]](/icons/layout.gif) | General IDC MarketScape Cloud Profesional Services.pdf | 2025-12-02 09:47 | 482K | |
![[ ]](/icons/layout.gif) | Cloud & Digital Transformation.pdf | 2025-10-29 12:01 | 485K | |
![[ ]](/icons/layout.gif) | 5 ways IT operations teams benefit from Red Hat OpenShift.pdf | 2025-10-15 16:06 | 494K | |
![[ ]](/icons/layout.gif) | Project vs. Program vs. Portfolio Management.pdf | 2025-09-17 13:45 | 501K | |
![[ ]](/icons/layout.gif) | Saviynt-ISPM-eBook.pdf | 2025-06-17 11:27 | 503K | |
![[ ]](/icons/layout.gif) | 143546_998 22342167_DC Power in Gigafactories_GMA_0.3.pdf | 2025-02-27 08:01 | 504K | |
![[ ]](/icons/layout.gif) | Demand Capture - wp-gpt-in-box-overview.pdf | 2025-03-06 13:16 | 505K | |
![[ ]](/icons/layout.gif) | 145198_Pervasive Creativity for the Enterprise 3.pdf | 2025-05-12 16:48 | 507K | |
![[ ]](/icons/layout.gif) | TeamViewer Software Reclaim eBook (1).pdf | 2025-12-02 11:49 | 517K | |
![[ ]](/icons/layout.gif) | 69786Key_Predictions_for_Energy_and_Industrials_in_2024_DoR.pdf | 2024-11-26 08:49 | 522K | |
![[ ]](/icons/layout.gif) | 73927AI_is_hard_so_how_do_you_fast_track_your_AI_initiatives.pdf | 2025-08-14 09:15 | 525K | |
![[ ]](/icons/layout.gif) | Artificial intelligence is transforming education.pdf | 2025-08-13 10:01 | 529K | |
![[ ]](/icons/layout.gif) | ai-pcs-and-the-need-for-professional-services-have-reset-customers-requirements-for-client-devices EN.pdf | 2025-08-25 07:12 | 530K | |
![[ ]](/icons/layout.gif) | 72310valoir_service_intelligence_report_1_.pdf | 2025-07-24 11:17 | 530K | |
![[ ]](/icons/layout.gif) | zebra-cs-dod-materiel-logistics-rfid-rtls-app-brief-en-us (1).pdf | 2025-04-29 10:43 | 543K | |
![[ ]](/icons/layout.gif) | NetApp AIPod Mini with Intel Partner Campaign-solution-brief-manufacturing Cyllene.pdf | 2025-10-24 15:11 | 547K | |
![[ ]](/icons/layout.gif) | 143912_HowTopSponsorsBuildStrongSiteRelationshipsThatLast.pdf | 2025-02-25 09:22 | 549K | |
![[ ]](/icons/layout.gif) | 73143Monotype_Font_Use_Survey_2024_1.pdf | 2025-08-18 08:12 | 551K | |
![[ ]](/icons/layout.gif) | Beyond checking boxes Unlocking the full potential of MITRE ATTCK with Google.pdf | 2025-07-28 11:13 | 560K | |
![[ ]](/icons/layout.gif) | 73688_EN_US_CS_53__future_of_manufacturing_industries_article__2_.pdf | 2025-08-28 10:38 | 562K | |
![[ ]](/icons/layout.gif) | ibm-generative-ai-assistants-the-complete-2024-buyers-guide.pdf | 2025-09-10 09:27 | 562K | |
![[ ]](/icons/layout.gif) | 703272025_Outlook_Life_Sciences_Leaders_on_Data__Digital_and_AI.pdf | 2024-12-03 16:03 | 563K | |
![[ ]](/icons/layout.gif) | 144565_Managed Security Readiness Guide EN (1).pdf | 2025-04-23 08:59 | 566K | |
![[ ]](/icons/layout.gif) | New Technology The Projected Total Economic Impact Of Adobe Acrobat AI Assistant.pdf | 2026-01-08 08:45 | 566K | |
![[ ]](/icons/layout.gif) | 74796998_24288577_GMA_All_Electric_Hospital_Whitepaper.pdf | 2026-01-22 08:38 | 567K | |
![[ ]](/icons/layout.gif) | 72360three_things_cio_want_from_ai_1_.pdf | 2025-07-24 10:27 | 580K | |
![[ ]](/icons/layout.gif) | Dynata_Comcast_Case_Study_2025_.pdf | 2025-10-23 15:15 | 580K | |
![[ ]](/icons/layout.gif) | 74270Automated_Engineering_Whitepaper.pdf | 2025-09-25 09:22 | 585K | |
![[ ]](/icons/layout.gif) | 141751_Optimizing Field Services with the Lytx Total Value Realization.pdf | 2024-12-23 08:53 | 590K | |
![[ ]](/icons/layout.gif) | Mobile-Remote-Access-Performance-Scalability-and-Security.pdf | 2025-07-03 07:39 | 611K | |
![[ ]](/icons/layout.gif) | 69821taiyo_line_up_brochure__1_.pdf | 2024-11-06 13:57 | 619K | |
![[ ]](/icons/layout.gif) | 72250eBook_APIM_in_the_Age_of_AI_1.pdf | 2025-09-19 12:08 | 632K | |
![[ ]](/icons/layout.gif) | eBook_APIM_in_the_Age_of_AI_1.pdf | 2024-11-20 13:47 | 633K | |
![[ ]](/icons/layout.gif) | 73111Ac3_Dataminr_and_Splunk_infographic_AU.pdf | 2025-06-30 14:28 | 635K | |
![[ ]](/icons/layout.gif) | Simplify Collaboration with a Lighter, Faster, More Durable Business Laptop (1).pdf | 2025-01-22 11:21 | 635K | |
![[ ]](/icons/layout.gif) | HR_tech_success_Your_guide_to_choosing_and_implementing_the_right_platform.pdf | 2025-03-06 12:58 | 636K | |
![[ ]](/icons/layout.gif) | 142084_POS_Buyers_GuideUS.pdf | 2025-04-10 15:38 | 656K | |
![[ ]](/icons/layout.gif) | zebra-cs-dod-fleet-maintenance-app-brief-en-us.pdf | 2025-04-29 10:37 | 658K | |
![[ ]](/icons/layout.gif) | 69904Procurement__1_.pdf | 2024-11-21 08:39 | 662K | |
![[ ]](/icons/layout.gif) | 153211_Snowflake Case Study Maven Clinic.pdf | 2026-03-25 14:02 | 665K | |
![[ ]](/icons/layout.gif) | 142807_ebookadtechandmediaplanning 1.pdf | 2025-01-02 09:23 | 666K | |
![[ ]](/icons/layout.gif) | 73851cl_top_considerations_for_generative_ai_ebook_1057715_202303_en.pdf | 2025-09-19 11:54 | 675K | |
![[ ]](/icons/layout.gif) | 147796_strata_networksecuritybuyersguidezhtw_asset3.pdf | 2025-07-22 08:04 | 677K | |
![[ ]](/icons/layout.gif) | 72589AI_Powering_smart_solutions_in_an_ever_changing_world.pdf | 2025-05-07 08:55 | 678K | |
![[ ]](/icons/layout.gif) | 143743_HXM0121 .pdf | 2025-01-24 08:31 | 679K | |
![[ ]](/icons/layout.gif) | 147041_960302_CORPS_OVW_IR_Magazine_RPRT_SC_250417_DIG.pdf | 2025-06-19 09:19 | 679K | |
![[ ]](/icons/layout.gif) | 73919co_5_steps_to_automate_business_1058150OM_202403_en.pdf | 2025-09-18 13:27 | 681K | |
![[ ]](/icons/layout.gif) | 142185_Forrester TEI of Docusign CLM_Q4 FY25.pdf | 2026-02-25 08:19 | 691K | |
![[ ]](/icons/layout.gif) | 148490_146425_ Operational Resilience in the Cloud_ From Reactive to Proactive in (1).pdf | 2025-12-09 08:18 | 693K | |
![[ ]](/icons/layout.gif) | 143740_GROW0051CFO .pdf | 2025-01-24 09:39 | 699K | |
![[ ]](/icons/layout.gif) | Generative AI in action.pdf | 2025-10-14 15:22 | 721K | |
![[ ]](/icons/layout.gif) | 73068EB___The_Payer_Imperative_Member_360_v6__1_.pdf | 2025-06-26 09:46 | 723K | |
![[ ]](/icons/layout.gif) | 144890_the_total_economic_impact_of_ibm_instana_observability_january_2024.pdf | 2025-02-21 17:15 | 724K | |
![[ ]](/icons/layout.gif) | 150088_20250430MACampaignHidden Value_cost optimization reportv4.pdf | 2025-11-25 09:20 | 733K | |
![[ ]](/icons/layout.gif) | frFR_NetApp-DS-4254-0924-Datasheet-v2_lo.pdf | 2025-04-03 14:20 | 734K | |
![[ ]](/icons/layout.gif) | SN + Nexon - eb-genai-guide.pdf | 2025-03-21 13:29 | 736K | |
![[ ]](/icons/layout.gif) | ZeroTrustGuideforSecurityLeaders.pdf | 2025-09-22 17:53 | 736K | |
![[ ]](/icons/layout.gif) | Infinity_ERM_2Pages.pdf | 2025-09-26 11:11 | 739K | |
![[ ]](/icons/layout.gif) | 140185_133182_112645_TMobile Education Internet Cradlepoint 5 Strategies for Wireless WANs 1 1 (1).pdf | 2025-12-12 10:57 | 750K | |
![[ ]](/icons/layout.gif) | 140185_133182_112645_TMobile Education Internet Cradlepoint 5 Strategies for Wireless WANs 1 1.pdf | 2024-12-26 17:14 | 750K | |
![[ ]](/icons/layout.gif) | 145569_AssetThe State of Workforce Security_Key Insights for IT and Security Leaders.pdf | 2025-06-27 10:43 | 769K | |
![[ ]](/icons/layout.gif) | 2 Increase security sustainability and efficiency with robust Dell server management tools.pdf | 2025-02-21 14:26 | 773K | |
![[ ]](/icons/layout.gif) | pov_protecting-water-systems.pdf | 2026-02-12 11:58 | 778K | |
![[ ]](/icons/layout.gif) | 145132_howtoselecttherightcontentmanagementsystemv2.pdf | 2025-05-13 10:54 | 779K | |
![[ ]](/icons/layout.gif) | 72270Boomi_Business_Case_for_CDC.pdf | 2025-09-12 12:50 | 783K | |
![[ ]](/icons/layout.gif) | 69715Getting_the_Basics_Right_10_Steps_to_a_More_Efficient_Close.pdf | 2025-02-07 10:54 | 793K | |
![[ ]](/icons/layout.gif) | 142774_How to Make Your Field Service Operations DataDriven.pdf | 2024-12-23 08:03 | 801K | |
![[ ]](/icons/layout.gif) | 74260revolutionizing_data_center_management_with_pon_technology_WP.pdf | 2025-11-10 11:15 | 802K | |
![[ ]](/icons/layout.gif) | Building-a-Unified-Mission-Ready-Future_Mattermost_11zon.pdf | 2025-04-21 15:18 | 803K | |
![[ ]](/icons/layout.gif) | 72229Autism_Family_Advocacy_OS_0225_CS.pdf | 2025-05-02 11:07 | 813K | |
![[ ]](/icons/layout.gif) | five-use-cases-to-help-fpa-professionals-take-back-their-time-fr.pdf | 2025-09-15 11:19 | 816K | |
![[ ]](/icons/layout.gif) | 141388_5G Powered Goverment.pdf | 2025-12-15 10:01 | 817K | |
![[ ]](/icons/layout.gif) | 6. Emerging Organizations Modernize Server Environments to Prepare for an AI-driven Future_EN.pdf | 2025-08-22 09:28 | 822K | |
![[ ]](/icons/layout.gif) | 72721Accelerate_Revenue_Generation_with_Intelligent_Sales_with_Copilot_Solution_Play_Asset.pdf | 2025-06-05 11:50 | 823K | |
![[ ]](/icons/layout.gif) | 090723e_BOM_Ebook_Software_Providers_Final.pdf | 2025-10-03 12:55 | 830K | |
![[ ]](/icons/layout.gif) | 73032998_22741150_Decarbonize_the_Office_Series_Unleash_the_power_of_digital_solutions_renovations_GMA_Whi.pdf | 2025-10-10 06:49 | 842K | |
![[ ]](/icons/layout.gif) | 71317The_IT_leader_s_guide_3_must_haves_for_enterprise_copilot_success.pdf | 2025-02-17 14:09 | 849K | |
![[ ]](/icons/layout.gif) | 72214building_cyber_resilient_data_recovery_strategy__JP_.pdf | 2025-06-12 11:39 | 851K | |
![[ ]](/icons/layout.gif) | Capture_Cost of Payroll_Great Transformation_AUS.pdf | 2025-11-21 12:30 | 853K | |
![[ ]](/icons/layout.gif) | 3605_VZ_Network Campaign_The invisible engines Article_01.05.25_EN_AF_AW_FINAL 120525_FR-compressed.pdf | 2025-08-12 16:20 | 871K | |
![[ ]](/icons/layout.gif) | 142329_142329_ Manufacturing Under Siege_ Navigating the Complex Cyber Threat Landscape-compressed.pdf | 2025-04-23 13:10 | 873K | |
![[ ]](/icons/layout.gif) | 144989_sedio a la fábrica Cómo sortear el complejo panorama de ciberamenazas-compressed.pdf | 2025-04-23 13:22 | 873K | |
![[ ]](/icons/layout.gif) | Best practices to engage and convert customers.pdf | 2026-01-22 08:52 | 875K | |
![[ ]](/icons/layout.gif) | 149093_149076_uobsustainabilitycompassreport_compressed.pdf | 2025-09-12 08:54 | 879K | |
![[ ]](/icons/layout.gif) | 71004The_Service_Management_Advantage_Helping_CIOs_Turn_IT_into_a_Strategic_Powerhouse.pdf | 2025-02-21 12:06 | 884K | |
![[ ]](/icons/layout.gif) | 147185_report2024stateofappsecurityreport.pdf | 2025-06-17 06:59 | 886K | |
![[ ]](/icons/layout.gif) | 143611_The Critical Importance of Connectivity in Delivering ExperienceOrchestrated Applications.pdf | 2025-12-12 08:52 | 888K | |
![[ ]](/icons/layout.gif) | alecta-elevates-internal-climate-risk-analytics-process-with-factset-carbon-diagnostics.pdf | 2026-03-23 08:39 | 889K | |
![[ ]](/icons/layout.gif) | 143926_TheRoleofDigitalToolinginAgriculture 1.pdf | 2025-02-25 09:16 | 892K | |
![[ ]](/icons/layout.gif) | Frame.io New productivity dimensions for creative workflows.pdf | 2025-08-05 08:23 | 893K | |
![[ ]](/icons/layout.gif) | 74436CIO_Business_Value_Guide.pdf | 2025-12-11 12:44 | 893K | |
![[ ]](/icons/layout.gif) | CIO Business Value Guide EN.pdf | 2025-09-01 11:26 | 893K | |
![[ ]](/icons/layout.gif) | 75518The_Ultimate_Guide_to_Migrating_Linux_Workloads_to_Azure.pdf | 2026-01-30 10:41 | 917K | |
![[ ]](/icons/layout.gif) | Research Note - BARC-Data-Monetization.pdf | 2025-06-17 11:18 | 921K | |
![[ ]](/icons/layout.gif) | 2. SMBs modernize for productivity, security, and AI future_EN.pdf | 2025-11-05 17:58 | 924K | |
![[ ]](/icons/layout.gif) | ALL LI ASSET The TEI of Checkr Study 2025.pdf | 2025-05-14 12:05 | 937K | |
![[ ]](/icons/layout.gif) | Power AI and Analytics Workloads with Performance.pdf | 2025-01-22 11:48 | 942K | |
![[ ]](/icons/layout.gif) | 70855drive_measurable_ai_success.pdf | 2025-01-17 08:46 | 943K | |
![[ ]](/icons/layout.gif) | How-far-will-AI-agents-go.pdf | 2025-08-25 17:53 | 945K | |
![[ ]](/icons/layout.gif) | 144971_GlobalFocusEO2025Executivesummaryfinal 2.pdf | 2025-03-06 13:50 | 946K | |
![[ ]](/icons/layout.gif) | 147063_Lenovo_Higher_Education_AI_Infographic_PH 1.pdf | 2025-05-28 08:46 | 947K | |
![[ ]](/icons/layout.gif) | How Cyber Threat Intelligence Empowers the CSuite.pdf | 2025-03-26 12:15 | 953K | |
![[ ]](/icons/layout.gif) | 142125_GitHubAi.Driven.DevOps.of.modern.software.developmenteBookKS_v0003.pdf | 2024-11-19 14:07 | 961K | |
![[ ]](/icons/layout.gif) | 143162_LNVHK_Q3MB_Qualcomm_ThinkPad_T14_Gen6_Infographic.pdf | 2024-12-12 10:29 | 1.0M | |
![[ ]](/icons/layout.gif) | Capture_Compliance_GreatTransformation_AUS2.pdf | 2025-11-21 12:09 | 1.0M | |
![[ ]](/icons/layout.gif) | 2025 10 Key Considerations for an IR Retainer.pdf | 2025-04-21 13:12 | 1.0M | |
![[ ]](/icons/layout.gif) | 146397_The call centre technology migration playbook-compressed.pdf | 2025-06-09 06:01 | 1.0M | |
![[ ]](/icons/layout.gif) | 140703_FY25Q1WP_Unlocking the Potential of Generative AI in Healthcare and Life Sciences.pdf | 2024-11-04 07:37 | 1.0M | |
![[ ]](/icons/layout.gif) | 3143933980Bitdefender-OEM-Sandbox-Technical-Brief-en.pdf | 2025-11-26 08:20 | 1.0M | |
![[ ]](/icons/layout.gif) | 145531_AAG_Secure_SDWAN_A4.pdf | 2025-06-26 10:12 | 1.0M | |
![[ ]](/icons/layout.gif) | 72908AWSMP_Q3_24_GenAI_Solution_Spotlight_Solution_Brief_Confluent_Final__4_.pdf | 2025-06-24 10:25 | 1.0M | |
![[ ]](/icons/layout.gif) | 5-ways-alteryx-delivers-faster-decisions-fr.pdf | 2025-09-15 11:24 | 1.0M | |
![[ ]](/icons/layout.gif) | Screenshot 2025-11-14 at 4.55.07 PM.pdf | 2025-11-14 11:32 | 1.0M | |
![[ ]](/icons/layout.gif) | zerow.pdf | 2025-09-22 17:56 | 1.0M | |
![[ ]](/icons/layout.gif) | 73786The_Great_Warehouse_Convergence.pdf | 2025-10-31 12:53 | 1.0M | |
![[ ]](/icons/layout.gif) | 145140_12264620apacfy24q1adobexaccenturecontentsupplychainfsireportfa.pdf | 2025-05-13 11:01 | 1.0M | |
![[ ]](/icons/layout.gif) | 141590_Success Guide for Finance Leaders in Financial Services Wild Tech.pdf | 2024-11-18 08:01 | 1.0M | |
![[ ]](/icons/layout.gif) | pfpt-us-eb-more-secure-together-proofpoint-microsoft.pdf | 2025-06-16 12:31 | 1.1M | |
![[ ]](/icons/layout.gif) | DSC_SyncoraDMP_Brochure_10_24_FINAL__1_.pdf | 2025-05-09 10:41 | 1.1M | |
![[ ]](/icons/layout.gif) | Cloud Print Services Landscape 2024.pdf | 2025-02-07 11:34 | 1.1M | |
![[ ]](/icons/layout.gif) | 74805_M365___EID__Cyber_Resilience_with_Veeam_Data_Cloud_and_Microsoft.pdf | 2025-12-08 07:37 | 1.1M | |
![[ ]](/icons/layout.gif) | Lunar Bank - Étude de Cas.pdf | 2025-07-29 17:56 | 1.1M | |
![[ ]](/icons/layout.gif) | 7555911420_bridging_the_procurement_and_supply_chain_gap__NCSU.pdf | 2026-01-30 10:03 | 1.1M | |
![[ ]](/icons/layout.gif) | 4481_AWS_AWS ISV Persona Campaign_Finance_eBook_FA.pdf | 2025-10-06 13:10 | 1.1M | |
![[ ]](/icons/layout.gif) | 143542_BTP0241AI 3 .pdf | 2025-01-24 08:44 | 1.1M | |
![[ ]](/icons/layout.gif) | Unveiling AI-Level Productivity (1).pdf | 2025-01-22 11:36 | 1.1M | |
![[ ]](/icons/layout.gif) | 145514_SC_TokenisationforFIs.pdf | 2025-04-07 07:40 | 1.1M | |
![[ ]](/icons/layout.gif) | 75961ModAIeBook_Modern_AI_Business_Workflows_eBook.pdf | 2026-03-18 10:01 | 1.1M | |
![[ ]](/icons/layout.gif) | 71641Driving_Expectations_Tackling_Retails_Biggest_Challenges.pdf | 2025-06-02 10:18 | 1.2M | |
![[ ]](/icons/layout.gif) | Unlocking efficiency with automation.pdf | 2025-08-04 10:50 | 1.2M | |
![[ ]](/icons/layout.gif) | Don't Wait to Refresh (2).pdf | 2025-01-22 11:44 | 1.2M | |
![[ ]](/icons/layout.gif) | 73113CS_Insurance_provider_Verato.pdf | 2025-06-26 09:38 | 1.2M | |
![[ ]](/icons/layout.gif) | Google Cloud Cybersecurity Forecast 2025.pdf | 2025-03-26 11:56 | 1.2M | |
![[ ]](/icons/layout.gif) | 72832ai_for_smb_guide_salesforce.pdf | 2025-06-18 11:32 | 1.2M | |
![[ ]](/icons/layout.gif) | Innovation - Ebook_FINAL_FRpdf.pdf | 2025-02-17 09:34 | 1.2M | |
![[ ]](/icons/layout.gif) | 150164_workforcerestructuringebookenusFINAL.pdf | 2025-12-17 08:15 | 1.2M | |
![[ ]](/icons/layout.gif) | 145320_Plus Adobe Compete One Pager Why Switching.pdf | 2025-04-11 10:40 | 1.2M | |
![[ ]](/icons/layout.gif) | 75012A_new_cooling_solution_for_a_rising_heat_problem_Liquid_cooling_meets_the_demands_of_tomorrow_s_workloads.pdf | 2025-11-10 11:03 | 1.2M | |
![[ ]](/icons/layout.gif) | 70485The_Strategic_Platform___Prioritizing_All_P2P_Needs__German_.pdf | 2024-12-19 12:06 | 1.2M | |
![[ ]](/icons/layout.gif) | 15-machine-learning-use-cases-to-solve-everyday-business-problems-de_compressed.pdf | 2025-04-15 10:37 | 1.3M | |
![[ ]](/icons/layout.gif) | 147784_PAL_Endpoint Buyers Guide_20250205_Finalzhtw_Traditonal Chinese-compressed.pdf | 2025-07-23 10:55 | 1.3M | |
![[ ]](/icons/layout.gif) | 712412024_Miercome_SSE_Benchmark_Report.pdf | 2025-02-20 16:01 | 1.3M | |
![[ ]](/icons/layout.gif) | 145138_B2BOnline2024ShopifyDeloitteRPT9.pdf | 2025-06-06 10:01 | 1.3M | |
![[ ]](/icons/layout.gif) | 141918_Practicalguidetowebmessaging_EN.pdf | 2025-07-02 10:22 | 1.3M | |
![[ ]](/icons/layout.gif) | Quotation_Global_Ai-powered_Autonomous_Well_Intervention_Market_Report.pdf | 2025-11-12 14:07 | 1.3M | |
![[ ]](/icons/layout.gif) | 147435_Essential Guide_Ebook_The ROI of Construction Project Management Software_Japan-compressed.pdf | 2025-07-21 07:15 | 1.3M | |
![[ ]](/icons/layout.gif) | 152396_IDC_Retail_Infobriefpdf (1).pdf | 2026-02-25 17:13 | 1.3M | |
![[ ]](/icons/layout.gif) | alteryx-spreadsheet-users-guide-to-modern-analytics-de-2_compressed.pdf | 2025-04-16 09:28 | 1.3M | |
![[ ]](/icons/layout.gif) | 144568_MDR Buyers Guide DE.pdf | 2025-04-23 10:15 | 1.3M | |
![[ ]](/icons/layout.gif) | 144567_MDR Buyers Guide FR.pdf | 2025-05-02 07:42 | 1.3M | |
![[ ]](/icons/layout.gif) | Unlock the power and potential of unified identity.pdf | 2025-05-07 13:52 | 1.3M | |
![[ ]](/icons/layout.gif) | 147068_US52632624.pdf | 2025-12-11 11:57 | 1.3M | |
![[ ]](/icons/layout.gif) | 142636_Novartis_IDC_White_Paper.pdf | 2025-01-28 08:20 | 1.3M | |
![[ ]](/icons/layout.gif) | 149097_Australia Adyen Index Hospitality 2025 Summary Australia.pdf | 2025-10-15 09:55 | 1.4M | |
![[ ]](/icons/layout.gif) | 71805Marketing_to_Trends_Watch_in_2025.pdf | 2025-04-08 15:00 | 1.4M | |
![[ ]](/icons/layout.gif) | Enfuce â__ Powering the future-Fuel card.pdf | 2025-10-10 14:46 | 1.4M | |
![[ ]](/icons/layout.gif) | 147376_CDRBuyersGuideFinalMarch2025-compressed.pdf | 2025-06-16 12:08 | 1.4M | |
![[ ]](/icons/layout.gif) | 74271TAC_900_062_GBL_EBK_How_Do_I_BOM_.pdf | 2025-09-25 10:14 | 1.4M | |
![[ ]](/icons/layout.gif) | 147652_idc-spotlight-paper-for-digital-labor.pdf | 2025-07-29 08:10 | 1.4M | |
![[ ]](/icons/layout.gif) | 141985_reporttransformingincidentmanagment.pdf | 2024-11-11 09:10 | 1.4M | |
![[ ]](/icons/layout.gif) | 143749_HXM0161SAP ERP HCM SAP SuccessFactors HXM .pdf | 2025-01-24 08:48 | 1.4M | |
![[ ]](/icons/layout.gif) | idc-report-maximizing-operations-with-ai.pdf | 2025-09-09 15:16 | 1.4M | |
![[ ]](/icons/layout.gif) | 10823_AUGUSTA_book_Ressources.pdf | 2025-07-15 12:01 | 1.4M | |
![[ ]](/icons/layout.gif) | 73336EcoCare_GMA_Condition_Based_Maintenance_White_Paper_FINAL.pdf | 2025-10-23 15:33 | 1.4M | |
![[ ]](/icons/layout.gif) | 143496_How SMBs Crack the Code on Cyber and Network Security.pdf | 2025-12-11 12:33 | 1.4M | |
![[ ]](/icons/layout.gif) | 69909CFO__1_.pdf | 2024-11-21 09:50 | 1.4M | |
![[ ]](/icons/layout.gif) | 140726_The Generative AI Advantage A Leaders Guide to Using Your Data as a Differentiator.pdf | 2025-01-16 09:08 | 1.4M | |
![[ ]](/icons/layout.gif) | 151099_Gracenote State of Play.pdf | 2026-02-13 13:09 | 1.4M | |
![[ ]](/icons/layout.gif) | 141142_225097WisewayStudy1b.pdf | 2025-12-12 12:12 | 1.4M | |
![[ ]](/icons/layout.gif) | 1783775454_Cloud-led perspective_v5.pdf | 2025-12-02 09:34 | 1.5M | |
![[ ]](/icons/layout.gif) | 719142024_JAGGAER_EBOOK_How_to_Unleash_Additional_Value_Despite_Increased_Category_Complexity_DE.pdf | 2025-06-24 10:40 | 1.5M | |
![[ ]](/icons/layout.gif) | 145281_auraeditionx9thinkpadrelinfographicwwen_0_downlaoded.pdf | 2025-03-12 13:30 | 1.5M | |
![[ ]](/icons/layout.gif) | Campaign content at the speed of generative AI-compressed.pdf | 2025-08-04 10:41 | 1.5M | |
![[ ]](/icons/layout.gif) | 2.03 the state of digital adoption 2025 (2).pdf | 2025-04-18 12:17 | 1.5M | |
![[ ]](/icons/layout.gif) | A Guide to Building an Effective Supplier Portal.pdf | 2025-01-20 09:17 | 1.5M | |
![[ ]](/icons/layout.gif) | JoinedUp _The invisible workforce challenge_Ebook_Tech_Target.pdf | 2025-02-27 13:55 | 1.5M | |
![[ ]](/icons/layout.gif) | Creating the Sustainable IT Department.pdf | 2025-01-22 11:26 | 1.5M | |
![[ ]](/icons/layout.gif) | 70708kasten_five_kubernetes_backup_best_practices.pdf | 2025-02-06 08:36 | 1.6M | |
![[ ]](/icons/layout.gif) | 139527_117166_Sustaining Student Connectivity Toolkit for Educators_2022 Update (1).pdf | 2024-12-26 17:16 | 1.6M | |
![[ ]](/icons/layout.gif) | 144230_Le guide du CRM pour les dbutants.pdf | 2025-06-12 16:54 | 1.6M | |
![[ ]](/icons/layout.gif) | Proofpoint Infographic Email Security fortify M365 (1).pdf | 2025-07-18 11:22 | 1.6M | |
![[ ]](/icons/layout.gif) | 141040_5.Workforce Upskilling for the AI Era.pdf | 2024-12-04 09:51 | 1.6M | |
![[ ]](/icons/layout.gif) | 73423MK_2592550_Broker_Connect_Employee_Navigator_Brochure_Final_compressed (1).pdf | 2025-09-25 10:57 | 1.6M | |
![[ ]](/icons/layout.gif) | Creating Quickfire Content with Adobe Express-compressed (1).pdf | 2025-08-04 11:22 | 1.6M | |
![[ ]](/icons/layout.gif) | 71292BI_2024_Cell_Banking___Characterization_eBook.pdf | 2025-02-17 14:43 | 1.6M | |
![[ ]](/icons/layout.gif) | 143330_nextstepsintheeraofdigitalbusinessreport 1 (1).pdf | 2025-05-05 14:31 | 1.6M | |
![[ ]](/icons/layout.gif) | 72682infoblox_analyst_report_analyzing_the_economic_benefits_of_infoblox_networking_and_security_management_in_multi_cloud_environment_jp.pdf | 2025-07-28 12:01 | 1.6M | |
![[ ]](/icons/layout.gif) | Demand Create - eb-ai-mod-apps.pdf | 2025-03-06 13:09 | 1.6M | |
![[ ]](/icons/layout.gif) | 74179SEEING_DOUBLE_HOW_VIRTUAL_TWINS_ADVANCE_INNOVATION_IN_AEROSPACE_AND_DEFENSE.pdf | 2025-09-17 13:44 | 1.6M | |
![[ ]](/icons/layout.gif) | 141328_CIMdata_eBook_ADPAG_Digital_Thread_Aras_2May2023_v3.pdf | 2025-01-06 06:17 | 1.6M | |
![[ ]](/icons/layout.gif) | 143609_TMobile_Asset_Tracking_infographic_07.25.23_final (1).pdf | 2025-12-11 15:54 | 1.6M | |
![[ ]](/icons/layout.gif) | 145599_ConnectedGovernmentReport2025Final-compressed.pdf | 2025-04-24 09:57 | 1.6M | |
![[ ]](/icons/layout.gif) | 139797_adedicatedcommercialbankingplatformismissioncriticalDGPNASRR24052584.pdf | 2025-01-29 09:26 | 1.6M | |
![[ ]](/icons/layout.gif) | Beyond the Dashboard-compressed.pdf | 2025-06-09 12:19 | 1.7M | |
![[IMG]](/icons/image2.gif) | Accelerating AI, automation, and innovation in modern enterprises.png | 2025-03-11 12:06 | 1.7M | |
![[ ]](/icons/layout.gif) | 141324-genai-platforms-buyers-guide.pdf | 2025-02-13 07:31 | 1.7M | |
![[ ]](/icons/layout.gif) | 143882-genai-platforms-buyers-guide.pdf | 2025-02-13 07:50 | 1.7M | |
![[ ]](/icons/layout.gif) | 150971_ebookunlockhealthcareinnovation.pdf | 2026-03-30 12:02 | 1.8M | |
![[ ]](/icons/layout.gif) | 705172025_Bringg_State_of_Last_Mile_Report_vF-compressed.pdf | 2025-05-09 11:07 | 1.8M | |
![[ ]](/icons/layout.gif) | 147484_Foushee_and_AssociatesConstructionHSICase Study2025.pdf | 2025-12-11 11:43 | 1.8M | |
![[ ]](/icons/layout.gif) | 143963_102024 eBook Insurance Technology Outlook v5 GBEN5 updated.pdf | 2025-02-27 08:09 | 1.8M | |
![[IMG]](/icons/image2.gif) | 142635_The Pharma Technology Playbook (1).png | 2025-01-28 07:46 | 1.8M | |
![[ ]](/icons/layout.gif) | 70516ReliaQuest_AI_Agent_Whitepaper_6.pdf | 2025-01-17 14:15 | 1.9M | |
![[ ]](/icons/layout.gif) | Altana_Critical_Minerals_Report.pdf | 2025-06-16 07:54 | 1.9M | |
![[ ]](/icons/layout.gif) | 8x8 Contact Center Buyer's Guide eBook.pdf | 2025-02-07 11:21 | 1.9M | |
![[ ]](/icons/layout.gif) | 146477_Buyersguide2025_KOKR.pdf | 2025-06-09 05:48 | 1.9M | |
![[ ]](/icons/layout.gif) | ECC-Hospitality-Full-PDF-TechTarget-UTM.pdf | 2025-10-31 10:33 | 1.9M | |
![[ ]](/icons/layout.gif) | gen-ai-transformation-accelerator.pdf | 2025-05-21 12:13 | 1.9M | |
![[ ]](/icons/layout.gif) | 69744_How_to_Pick_Winning_Value_and_Growth_Stocks.pdf | 2024-11-18 11:56 | 1.9M | |
![[ ]](/icons/layout.gif) | 148396_AgenticAISurveyReport_FINAL.pdf | 2025-10-22 08:47 | 1.9M | |
![[ ]](/icons/layout.gif) | 140048_PBS26697_MultiLine Campaign 2024_Infographic_FINAL.pdf | 2025-12-11 17:55 | 1.9M | |
![[ ]](/icons/layout.gif) | 148662_Pricing Guide for B2B SaaS Founders UK.pdf | 2025-12-19 10:26 | 1.9M | |
![[ ]](/icons/layout.gif) | 75962CreateWithConfidence_Create_with_Confidence_eBook_UE__1_.pdf | 2026-03-20 12:44 | 2.0M | |
![[ ]](/icons/layout.gif) | Creating with Confidence Using Generative AI with Integrity.pdf | 2026-01-05 10:28 | 2.0M | |
![[ ]](/icons/layout.gif) | HR Takes the Lead_ Strategies for Growth-Focused Organizations.pdf | 2025-03-12 13:52 | 2.0M | |
![[ ]](/icons/layout.gif) | 145282_auraeditionx9thinkpadsmbinfographicwwen_downloaded.pdf | 2025-03-12 13:25 | 2.0M | |
![[ ]](/icons/layout.gif) | 73786Elevating_Every_Move.pdf | 2025-10-31 12:52 | 2.0M | |
![[ ]](/icons/layout.gif) | 72041SyncoraDMP_Data_Driven_Infographic.pdf | 2025-05-09 10:35 | 2.0M | |
![[ ]](/icons/layout.gif) | Discover whats shaping data and analytics strategies.pdf | 2026-01-16 11:34 | 2.0M | |
![[ ]](/icons/layout.gif) | 72188Build_your_international_teams_quickly_and_easily_with_G_P.pdf | 2025-04-14 08:22 | 2.0M | |
![[ ]](/icons/layout.gif) | Use_cases_BUILD_your_international_team_quickly_and_easily_2023__1_.pdf | 2025-03-21 11:08 | 2.0M | |
![[ ]](/icons/layout.gif) | 74679DE_Jabra_PanaCast_Videolösungen.pdf | 2025-12-03 09:02 | 2.0M | |
![[ ]](/icons/layout.gif) | 73299EB1_V2_EN.pdf | 2025-09-16 14:38 | 2.1M | |
![[ ]](/icons/layout.gif) | 74496From_Risk_to_Resilience_Securing_Kubernetes_Compliance_.pdf | 2025-10-28 09:01 | 2.1M | |
![[ ]](/icons/layout.gif) | Networking at Scale for AI lessons from industry leaders_French.pdf | 2025-08-12 12:12 | 2.1M | |
![[ ]](/icons/layout.gif) | SwiftDecoder_Smart_Data_Capture_Whitepaper_Final.pdf | 2024-11-15 16:37 | 2.1M | |
![[ ]](/icons/layout.gif) | 151895_reportthreatpredictions2026.pdf | 2026-02-24 09:27 | 2.2M | |
![[ ]](/icons/layout.gif) | 74870Assessment__Planning__and_Migration_Preparation__1_.pdf | 2025-12-11 07:40 | 2.2M | |
![[ ]](/icons/layout.gif) | EB_8x8_Modern_CX_Unleashed_FINAL-compressed.pdf | 2025-06-04 11:21 | 2.2M | |
![[ ]](/icons/layout.gif) | 149182_LNVGTAP_Q2MB_Win11_SecurityAssess (1).pdf | 2025-09-12 08:37 | 2.2M | |
![[ ]](/icons/layout.gif) | 143539_BTP0231 5 .pdf | 2025-01-24 08:57 | 2.2M | |
![[ ]](/icons/layout.gif) | 145323_Secure learning and teaching for K12 schools with Lenovo education solutions.pdf | 2025-03-20 09:55 | 2.2M | |
![[ ]](/icons/layout.gif) | 147214_2. APAC Region Report.pdf | 2025-07-17 07:23 | 2.2M | |
![[ ]](/icons/layout.gif) | 146972_2025 SDM Report APAC Final-compressed.pdf | 2025-05-22 13:58 | 2.2M | |
![[ ]](/icons/layout.gif) | 145224_DoD TPriority Infographic IDC.pdf | 2025-12-15 10:05 | 2.2M | |
![[ ]](/icons/layout.gif) | Building-a-Unified-Mission-Ready-Future_Mattermost_11zon (1).pdf | 2025-04-21 15:19 | 2.2M | |
![[ ]](/icons/layout.gif) | 146856_fy26aecoaviationairportsindustryperspectiveebookenanz (1).pdf | 2025-05-22 13:50 | 2.2M | |
![[ ]](/icons/layout.gif) | 7465173408_10_Steps_to_Cloud_Resilience.pdf | 2025-10-29 10:31 | 2.2M | |
![[ ]](/icons/layout.gif) | 141994_DWS Asset_LNVGTAP_Q3MB_AI_DWS_CareofOne_Brochure.pdf | 2024-11-06 10:07 | 2.3M | |
![[ ]](/icons/layout.gif) | 145060_Asset 1.pdf | 2025-03-21 12:40 | 2.3M | |
![[ ]](/icons/layout.gif) | KI zum Einsatz bringen â__ Finanzen (1)-compressed.pdf | 2025-10-20 11:29 | 2.3M | |
![[ ]](/icons/layout.gif) | 149275_Standard Chartered Bankable Insights TB emag Issue 2 2025.pdf | 2025-09-29 12:21 | 2.3M | |
![[ ]](/icons/layout.gif) | 7555911464_GEP_Outlook_2026__Procurement___Supply_Chain.pdf | 2026-02-06 08:17 | 2.3M | |
![[ ]](/icons/layout.gif) | 149003_LNVGTAP_Q2MB_AMDGoBig_Whitepaper-compressed.pdf | 2025-09-03 10:51 | 2.3M | |
![[ ]](/icons/layout.gif) | CIO_PASS-2.pdf | 2025-01-21 13:16 | 2.3M | |
![[ ]](/icons/layout.gif) | 145146_LNVGTAP_Q4MB_DWS_AISvcs_CareofOneBrochure.pdf | 2025-03-27 12:09 | 2.3M | |
![[ ]](/icons/layout.gif) | Portugal (Brazil) Next_campaign_megatrends_e-book(pt-BR)_Final-compressed.pdf | 2025-05-12 08:20 | 2.4M | |
![[ ]](/icons/layout.gif) | 145466_Madison Logic 2025FullFunnelABMPlaybook.pdf | 2025-03-27 12:00 | 2.4M | |
![[ ]](/icons/layout.gif) | 143980_Shopify_Site_Speed_Guide.pdf | 2025-03-17 10:24 | 2.4M | |
![[ ]](/icons/layout.gif) | software-firewalls-for-dummies (1).pdf | 2026-02-11 13:24 | 2.4M | |
![[ ]](/icons/layout.gif) | ESCODE CEFPRO REPORT 2024 1.pdf | 2025-01-06 13:20 | 2.4M | |
![[ ]](/icons/layout.gif) | 71828mitigating_risk_2024_eBook_Mitigating_Risk.pdf | 2025-04-16 10:56 | 2.4M | |
![[ ]](/icons/layout.gif) | 2025-identity-security-landscape (5) (1).pdf | 2025-06-04 11:45 | 2.4M | |
![[ ]](/icons/layout.gif) | 147476_LNVGTAP_Q1MB_AMDGoBig__Hybrid201_WhitePaper.pdf | 2025-06-24 11:09 | 2.4M | |
![[ ]](/icons/layout.gif) | 147177_Beating the new generation of fraudsters VISA.pdf | 2025-06-26 09:54 | 2.4M | |
![[ ]](/icons/layout.gif) | 143883_how-ai-assistants-drive-real-business-value-vanguard-report.pdf | 2025-02-21 17:09 | 2.4M | |
![[ ]](/icons/layout.gif) | how-ai-assistants-drive-real-business-value-vanguard-report.pdf | 2025-09-10 09:38 | 2.4M | |
![[ ]](/icons/layout.gif) | Cyber Vision_datasheet-c78-743222.pdf | 2025-07-24 09:18 | 2.4M | |
![[ ]](/icons/layout.gif) | 70845unit4_br_pso_7_core_skills_of_great_cfos_BR220906BNL.pdf | 2025-01-14 08:30 | 2.4M | |
![[ ]](/icons/layout.gif) | 147246_LNVID_Q1MB_Win11_TruScaleChklist_MSJS.pdf | 2025-06-05 09:58 | 2.5M | |
![[ ]](/icons/layout.gif) | pfpt-fr-eb-more-secure-together-proofpoint-microsoft.pdf | 2025-06-16 08:13 | 2.5M | |
![[ ]](/icons/layout.gif) | travel-guide-to-modernizing-the-data-stack-fr.pdf | 2025-09-15 11:13 | 2.5M | |
![[ ]](/icons/layout.gif) | 73888banking_service_playbook_2024_EN_US_CS_276___FINAL_salesforce_5_playbook_web_111524.pdf | 2025-10-01 13:04 | 2.5M | |
![[ ]](/icons/layout.gif) | More-Secure-Together-Microsoft-and-Proofpoint.pdf | 2025-10-28 09:42 | 2.5M | |
![[ ]](/icons/layout.gif) | 71794Compliance_Playbook_How_to_Improve_Speed_to_Hire_1__1_.pdf | 2025-04-14 10:07 | 2.5M | |
![[ ]](/icons/layout.gif) | 1. esg-ai-enablement-built-in-security-features-on-modern-storage-environments-ebook_EN.pdf | 2025-11-05 18:10 | 2.5M | |
![[ ]](/icons/layout.gif) | 146289_US52756724IG.pdf | 2025-12-12 11:09 | 2.5M | |
![[ ]](/icons/layout.gif) | Samsung & Android Security Whitepaper_Moder.pdf | 2026-02-11 13:23 | 2.5M | |
![[ ]](/icons/layout.gif) | 69860TeamDynamix_eBook___Automate_IT.pdf | 2024-11-08 11:00 | 2.6M | |
![[ ]](/icons/layout.gif) | CNH_Industrial.pdf | 2025-02-04 09:52 | 2.6M | |
![[ ]](/icons/layout.gif) | 144873_csecommercegrowthguide_special programs_11zon (1).pdf | 2025-06-06 10:27 | 2.6M | |
![[ ]](/icons/layout.gif) | 149094_LNVGTAP_Q2MB_AMDGoBig_Whitepaper_compressed.pdf | 2025-09-11 09:18 | 2.6M | |
![[ ]](/icons/layout.gif) | 149098_LNVGTAP_Q2MB_AMDGoBig_Whitepaper_compressed.pdf | 2025-09-09 13:12 | 2.6M | |
![[ ]](/icons/layout.gif) | Navigating_the_maze_of_Nonprofit_Reporting_WP210224INT.pdf | 2025-01-14 09:29 | 2.6M | |
![[ ]](/icons/layout.gif) | 145365_LNVAP_FY2425Q1_Win11Asst_TA3_OppBeyondWin11_Brochure_2.pdf | 2025-03-19 10:48 | 2.7M | |
![[ ]](/icons/layout.gif) | 15_Stories_EA_FY24-compressed.pdf | 2025-04-28 14:18 | 2.7M | |
![[ ]](/icons/layout.gif) | Maximize your data insights with AI.pdf | 2025-03-27 12:40 | 2.7M | |
![[ ]](/icons/layout.gif) | ca-as-cross-lg-nss-qua-iso9001-mp-quality-0625-report (2)-compressed.pdf | 2025-06-17 11:10 | 2.7M | |
![[ ]](/icons/layout.gif) | 143985_Enhancing Rapid Response with TPriority and MCPTT12.10.24.pdf | 2025-12-11 11:38 | 2.7M | |
![[ ]](/icons/layout.gif) | 145572_CS Asset_Cortex Indigo_451ResearchPaloAltoNetworksMigrating.pdf | 2025-07-04 09:00 | 2.7M | |
![[ ]](/icons/layout.gif) | 135590_Telecom Driving Success.pdf | 2025-01-08 12:00 | 2.7M | |
![[ ]](/icons/layout.gif) | 71709pso_br_7_core_skills_of_great_cfos_BR220906INT.pdf | 2025-06-18 11:50 | 2.7M | |
![[ ]](/icons/layout.gif) | Finance for Dummies.pdf | 2025-06-09 12:53 | 2.8M | |
![[ ]](/icons/layout.gif) | how_ai_enabled_demand_planning_is_changing_the_way_we_work__1_.pdf | 2025-01-08 11:52 | 2.8M | |
![[ ]](/icons/layout.gif) | 5-Steps-to-Optimisation-compressed.pdf | 2025-09-05 12:30 | 2.8M | |
![[ ]](/icons/layout.gif) | 143311_16891_PAN2305_SOC_TransformationGuide_R7Final_020824.pdf | 2025-02-24 09:47 | 2.8M | |
![[ ]](/icons/layout.gif) | Buyers guide v3 (1).pdf | 2025-01-13 13:40 | 2.8M | |
![[ ]](/icons/layout.gif) | mulesoft-whitepaper-cio-guide-to-integration.pdf | 2025-02-14 16:08 | 2.8M | |
![[ ]](/icons/layout.gif) | 143169_Rethinking financial services intelligence for the generative AI era (1).pdf | 2025-01-28 07:54 | 2.8M | |
![[ ]](/icons/layout.gif) | 69900Report_API_State_of_the_Market_2024.pdf | 2024-11-20 14:06 | 2.8M | |
![[ ]](/icons/layout.gif) | 8-Benefits-of-a-Backup-Service-for-Microsoft-365.pdf | 2025-10-28 09:29 | 2.8M | |
![[ ]](/icons/layout.gif) | FINAL_8-benefits-of-backup-service-for-m365 (2).pdf | 2024-11-21 07:43 | 2.8M | |
![[ ]](/icons/layout.gif) | 146780_Standard Chartered TB Bankable Insights Client eMag Iss 1.2025.pdf | 2025-05-27 08:20 | 2.8M | |
![[ ]](/icons/layout.gif) | Google Clouds Product Vision for AIPowered Security.pdf | 2025-03-24 11:58 | 2.9M | |
![[ ]](/icons/layout.gif) | 69907IT__1_.pdf | 2024-11-21 09:38 | 2.9M | |
![[ ]](/icons/layout.gif) | 72075redefining_universal_ztna.pdf | 2025-04-11 12:28 | 2.9M | |
![[ ]](/icons/layout.gif) | 150951_Completing the AI Story How ISVs Can Maximize Their AI Investment with Docusign Embed 1.pdf | 2026-03-04 15:52 | 2.9M | |
![[ ]](/icons/layout.gif) | 73959ameritas_customer_story.pdf | 2025-08-28 07:40 | 2.9M | |
![[ ]](/icons/layout.gif) | 147638_threatlandscapereport2025.pdf | 2025-12-19 10:17 | 3.0M | |
![[ ]](/icons/layout.gif) | 70395 - Pulseway.pdf | 2024-12-13 10:26 | 3.0M | |
![[ ]](/icons/layout.gif) | FINAL_CFO_Forum_Journal_Finance.pdf | 2025-07-09 14:48 | 3.0M | |
![[ ]](/icons/layout.gif) | 72567SailPoint_Horizons_of_Identity_Security_Interactive_Book_IB2560__1_-compressed.pdf | 2025-05-08 07:42 | 3.0M | |
![[ ]](/icons/layout.gif) | KI-Open-Banking-und-die-wachsende-Cyber-Bedrohung.pdf | 2025-07-31 08:26 | 3.0M | |
![[ ]](/icons/layout.gif) | 139659_6.Work and Innovate Everywhere.pdf | 2024-12-11 07:01 | 3.0M | |
![[ ]](/icons/layout.gif) | 8 Ways Software Companies_BDM_eBook.pdf | 2025-08-05 15:25 | 3.0M | |
![[ ]](/icons/layout.gif) | pfpt-es-eb-smarter-faster-email-security.pdf | 2025-06-16 12:45 | 3.0M | |
![[ ]](/icons/layout.gif) | Trends_in_Data_and_Analytics_for_Sales.pdf | 2024-11-15 17:41 | 3.1M | |
![[ ]](/icons/layout.gif) | LD_OnePager (2).pdf | 2025-01-24 13:34 | 3.1M | |
![[ ]](/icons/layout.gif) | 75507規制コンプライアンスの解明.pdf | 2026-01-16 11:27 | 3.1M | |
![[ ]](/icons/layout.gif) | 143737_DSC0091AI.pdf | 2025-01-24 09:30 | 3.1M | |
![[ ]](/icons/layout.gif) | 145229_24ADBECCFIO_FireflyProductGuide APAC.pdf | 2025-03-26 12:07 | 3.1M | |
![[ ]](/icons/layout.gif) | 74782_FR_FabricRTIPurview_POVGuide.pdf | 2025-11-06 11:51 | 3.1M | |
![[ ]](/icons/layout.gif) | 7478374677_74031_IT_FabricRTIPurview_POVGuide.pdf | 2025-11-06 12:04 | 3.1M | |
![[ ]](/icons/layout.gif) | 144132-ai_demands_new_ways_of_data_management.pdf | 2025-02-13 09:33 | 3.1M | |
![[ ]](/icons/layout.gif) | 147655_ai_demands_new_ways_of_data_management.pdf | 2025-07-29 07:54 | 3.1M | |
![[ ]](/icons/layout.gif) | 73224guide_own_your_brand.pdf | 2025-07-22 14:48 | 3.1M | |
![[ ]](/icons/layout.gif) | 704892024_Mid_Market_Coupa_Total_Spend_Management_Benchmark_Report____Landscape_Digital_Copy__German_.pdf | 2024-12-19 12:39 | 3.2M | |
![[ ]](/icons/layout.gif) | 704852024_Coupa_Total_Spend_Management_Benchmark_Report_compressed.pdf | 2024-12-19 11:59 | 3.2M | |
![[ ]](/icons/layout.gif) | 150086_20250430MACampaignHidden Value_winning on valueHKv3.pdf | 2025-12-01 08:43 | 3.2M | |
![[ ]](/icons/layout.gif) | 143173_LNVGTAP_Q3MB_EdVision_Infographic.pdf | 2024-12-13 09:25 | 3.2M | |
![[ ]](/icons/layout.gif) | 147184_Supercharge Financial Resilience with AI Observability.pdf | 2025-06-09 06:10 | 3.2M | |
![[ ]](/icons/layout.gif) | 73859Accelerating_AI_success_How_organizations_are_using_AI_to_solve_their_biggest_challenges.pdf | 2025-08-29 11:46 | 3.3M | |
![[ ]](/icons/layout.gif) | 74186MASTERING_ENTERPRISE_WIDE_FAST_MOVING_CONSUMER_GOODS__FMCG__OPERATIONS__2_.pdf | 2025-09-19 13:36 | 3.3M | |
![[ ]](/icons/layout.gif) | Article TechTarget PDF-Staffing-6 Metrics Time to Placement_Q125.pdf | 2025-05-14 12:21 | 3.3M | |
![[ ]](/icons/layout.gif) | 147180_LNVAU_Q1MB_Edu_DWS_Infographic.pdf | 2025-05-28 11:47 | 3.3M | |
![[ ]](/icons/layout.gif) | the_connected_financial_services_report_2023_de.pdf | 2024-11-15 17:02 | 3.4M | |
![[ ]](/icons/layout.gif) | 145980_Secure SD WAN and SWG for enhanced branch security and the foundation for SASE JP.pdf | 2025-06-26 10:03 | 3.4M | |
![[ ]](/icons/layout.gif) | 149372_LNVHK_Q2MB_Win11_UpgradeGuide_ContentSyndication (1).pdf | 2025-09-26 13:02 | 3.4M | |
![[ ]](/icons/layout.gif) | vicarius-vrx (2).pdf | 2025-03-13 12:43 | 3.4M | |
![[ ]](/icons/layout.gif) | GOTO0163_Resolve_EB_SMB_ITBuyer_NA_EN_BuyersGuide (1).pdf | 2025-06-17 10:53 | 3.4M | |
![[ ]](/icons/layout.gif) | 144546_howtocombatmoderncyberthreatswithintegratedendpointsecurityandmanageabilityebook EN (1).pdf | 2025-05-06 13:43 | 3.5M | |
![[ ]](/icons/layout.gif) | unleash_digital_labor_with_agentforce.pdf | 2025-11-05 09:41 | 3.5M | |
![[ ]](/icons/layout.gif) | 140044_126754_107445_92855_SPR22390GovFleetMgmtSlideshare04AW_CCfixtoURL.pdf | 2024-12-26 17:13 | 3.5M | |
![[ ]](/icons/layout.gif) | 149556_TFB_RoS_Construction_eBook_25SMBCSYN.pdf | 2025-12-12 12:42 | 3.5M | |
![[ ]](/icons/layout.gif) | 140638_contenfulforcpg 1.pdf | 2024-12-23 08:22 | 3.5M | |
![[ ]](/icons/layout.gif) | 150237_10WaystoTransformYourWorkwithAIinSlack_final.pdf | 2025-12-02 10:14 | 3.5M | |
![[ ]](/icons/layout.gif) | 72704Beliebte_Corporate_Benefits__um_die_Mitarbeiterzufriedenheit_nachhaltig_zu_steigern.pdf | 2025-05-19 11:03 | 3.5M | |
![[ ]](/icons/layout.gif) | 149979_Workday Workday HCM vs UKG Pro Competitive Report (1).pdf | 2025-12-15 09:51 | 3.5M | |
![[ ]](/icons/layout.gif) | consumer_goods_profitable_growth_playbook.pdf | 2025-09-10 10:45 | 3.5M | |
![[ ]](/icons/layout.gif) | 143166_The Generative AI Advantage A Leaders Guide to Using Your Data as a Differentiator_SUP edition_FR_CA.pdf | 2025-01-16 09:00 | 3.5M | |
![[ ]](/icons/layout.gif) | 141765_TFEANSHigherEdeBook (1).pdf | 2025-12-12 11:04 | 3.5M | |
![[ ]](/icons/layout.gif) | 69679Strengthening_Security_Operations_with_Data_and_AI.pdf | 2024-11-05 08:25 | 3.5M | |
![[ ]](/icons/layout.gif) | 73991_F_S_x_Zoom_vBook___The_Next_Evolution_of_CX_Are_you_ready_for_the_next_evolution_of_CX_.pdf | 2025-08-26 08:05 | 3.6M | |
![[ ]](/icons/layout.gif) | 150865_Acer250207_Q1_Assets_Production_Letter_final.pdf | 2025-12-15 09:56 | 3.6M | |
![[ ]](/icons/layout.gif) | 151302_Acer250207_Q1_Assets_Production_Letter_final.pdf | 2026-01-09 09:33 | 3.6M | |
![[ ]](/icons/layout.gif) | How Businesses Can Turn Value Chain Resilience and Compliance into Value Creation (2).pdf | 2025-06-16 08:01 | 3.6M | |
![[ ]](/icons/layout.gif) | 71716In_Store_Experiences_Playbook_FR_compressed.pdf | 2025-06-24 10:51 | 3.6M | |
![[ ]](/icons/layout.gif) | 145375_5 tactiques pour une 1-compressed.pdf | 2025-05-22 12:08 | 3.6M | |
![[ ]](/icons/layout.gif) | 73890In_Store_Experiences_Playbook_FR_compressed.pdf | 2025-12-03 10:34 | 3.6M | |
![[ ]](/icons/layout.gif) | pdf.pdf | 2025-05-08 12:30 | 3.7M | |
![[ ]](/icons/layout.gif) | Maturity Model Guide v.1.2.pdf | 2025-02-10 14:35 | 3.7M | |
![[ ]](/icons/layout.gif) | GC-400-ISV_transform-biz-ps.pdf | 2024-11-21 10:24 | 3.7M | |
![[ ]](/icons/layout.gif) | 74679Jabra_TL_VisibilityReport_DE.pdf | 2025-12-03 09:09 | 3.7M | |
![[ ]](/icons/layout.gif) | 74750_EN_US_CS_102__3rd_edition_field_service_guide__1_.pdf | 2026-01-08 16:14 | 3.7M | |
![[ ]](/icons/layout.gif) | RP-ONG-GL-DF-2024-Payroll-Complexity-Survey-Y28b49kjNa (1).pdf | 2025-02-10 09:36 | 3.7M | |
![[ ]](/icons/layout.gif) | Detection_Design_Guide_PPC_tt1w9o.pdf | 2025-01-10 08:35 | 3.7M | |
![[ ]](/icons/layout.gif) | Product-led growth in the AI-era.pdf | 2025-11-25 12:56 | 3.7M | |
![[ ]](/icons/layout.gif) | 70848br_historic_opportunity_public_sector.pdf | 2025-01-14 09:33 | 3.8M | |
![[ ]](/icons/layout.gif) | 149021_LNVTW_Q2MB_Manuf_SmarterDWS_Infograph_TW.pdf | 2025-09-12 08:24 | 3.8M | |
![[ ]](/icons/layout.gif) | 142106_download.pdf | 2025-02-17 06:55 | 3.8M | |
![[ ]](/icons/layout.gif) | How Shopify and EY Power OAK FORTs Upmarket Journey.pdf | 2024-11-20 15:12 | 3.8M | |
![[ ]](/icons/layout.gif) | 70894modernizing_data_strategic_purpose.pdf | 2025-01-23 09:50 | 3.9M | |
![[ ]](/icons/layout.gif) | 70480 - Blue Yonder.pdf | 2024-12-19 10:52 | 3.9M | |
![[ ]](/icons/layout.gif) | 72153Bridging_the_Care_Gap_Rethinking_Member_Connections_in_a_Digital_First_World.pdf | 2025-04-11 12:39 | 3.9M | |
![[ ]](/icons/layout.gif) | 142907_Standard Chartered Transaction Banking Bankable Insights Issue 4 Sibos 2024.pdf | 2024-12-06 13:39 | 3.9M | |
![[ ]](/icons/layout.gif) | 145990_putaitoworkforfinance (1).pdf | 2025-11-26 08:06 | 3.9M | |
![[ ]](/icons/layout.gif) | put-ai-to-work-for-finance.pdf | 2025-09-10 10:28 | 3.9M | |
![[ ]](/icons/layout.gif) | 74649Hinge_Health_Unified_Care_eBook_2025__1_.pdf | 2025-11-24 11:16 | 3.9M | |
![[ ]](/icons/layout.gif) | the-spreadsheet-users-guide-to-modern-finance-analytics-fr.pdf | 2025-09-15 11:16 | 3.9M | |
![[ ]](/icons/layout.gif) | 150715_aonglobalmedicaltrendratesreport2026.pdf | 2025-12-19 09:52 | 4.0M | |
![[ ]](/icons/layout.gif) | 150079_148574_CHAPTERS 16 PDF.pdf | 2025-10-27 15:30 | 4.0M | |
![[ ]](/icons/layout.gif) | 148502_AUTODE1.pdf | 2025-08-20 12:32 | 4.0M | |
![[ ]](/icons/layout.gif) | Deloitte_and_SailPoint_report_012125__2_.pdf | 2025-04-28 12:48 | 4.1M | |
![[ ]](/icons/layout.gif) | 148795_sasefordummies.pdf | 2025-12-24 08:09 | 4.1M | |
![[ ]](/icons/layout.gif) | 71353NVIDIA_Blackwell_Solutions_End_to_End_AI_Data_Center_Building_Block_Solutions.pdf | 2025-03-06 09:53 | 4.1M | |
![[ ]](/icons/layout.gif) | 75636Adobe_ShipStation_Portrait_eBook_v3_2__1_.pdf | 2026-01-22 10:05 | 4.1M | |
![[ ]](/icons/layout.gif) | the-state-of-teams-2025-compressed.pdf | 2025-06-04 12:12 | 4.1M | |
![[ ]](/icons/layout.gif) | How to Improve the ROI of Personalization at Scale in the Era of AI.pdf | 2026-01-16 11:35 | 4.2M | |
![[ ]](/icons/layout.gif) | Google Cloud Infoblox Infographic SQl.pdf | 2025-12-11 18:09 | 4.2M | |
![[ ]](/icons/layout.gif) | 143535_drones.pdf | 2025-12-11 15:42 | 4.2M | |
![[ ]](/icons/layout.gif) | 704852024_Coupa_Total_Spend_Management_Benchmark_Report__French__France_.pdf | 2024-12-19 11:49 | 4.3M | |
![[ ]](/icons/layout.gif) | the_ai_academy_guidebook_putting_ai_to_work_for_talent_management.pdf | 2025-04-16 09:46 | 4.3M | |
![[ ]](/icons/layout.gif) | DE_Declarative_Device_Management_(DDM)_White_Paper.pdf | 2024-11-19 10:51 | 4.3M | |
![[ ]](/icons/layout.gif) | 73840Cloud_Security_Risk_Report_compressed.pdf | 2025-09-30 13:52 | 4.3M | |
![[ ]](/icons/layout.gif) | 1.pdf | 2025-03-03 09:52 | 4.3M | |
![[ ]](/icons/layout.gif) | 152790_WhyChooseDocusignCLM.pdf | 2026-03-27 12:31 | 4.3M | |
![[ ]](/icons/layout.gif) | 147788_Aon_The CFO Roadmap Bettter Decisions for Multidimensional Growth_Report 2.pdf | 2025-08-22 09:42 | 4.3M | |
![[ ]](/icons/layout.gif) | 2025-buyer-s-guide-to-ibm-observability-products (1).pdf | 2025-09-02 13:43 | 4.4M | |
![[ ]](/icons/layout.gif) | 150254_Spotlight on AI in Media Entertainment (1).pdf | 2025-10-28 13:21 | 4.4M | |
![[ ]](/icons/layout.gif) | 147287_972_4 VFC B2B Infographic_v1 design_30 May.pdf | 2025-06-19 09:26 | 4.4M | |
![[ ]](/icons/layout.gif) | 68712.pdf | 2024-11-06 13:50 | 4.4M | |
![[ ]](/icons/layout.gif) | 74693NCS_The_AI_Gambit_Whitepaper.pdf | 2025-11-14 11:39 | 4.4M | |
![[ ]](/icons/layout.gif) | 146509_mulesoftforagentforcewhitepaper.pdf | 2025-06-16 11:34 | 4.4M | |
![[ ]](/icons/layout.gif) | 3-genai-use-cases-that-immediately-benefit-finance-departments-de.pdf | 2025-04-15 10:23 | 4.5M | |
![[ ]](/icons/layout.gif) | 72118responsible_ai_governance_trust.pdf | 2025-05-08 11:06 | 4.5M | |
![[ ]](/icons/layout.gif) | Discover AWS for software companies_CPO_eBook.pdf | 2025-07-24 07:26 | 4.5M | |
![[ ]](/icons/layout.gif) | 152132_Privatecapitalbuyersguideinvestingfundraisingplatforms.pdf | 2026-02-23 08:39 | 4.5M | |
![[ ]](/icons/layout.gif) | built-for-growth.pdf | 2025-07-14 08:36 | 4.5M | |
![[ ]](/icons/layout.gif) | 150880_Agentic_commerce_for_retail.pdf | 2025-12-19 10:13 | 4.6M | |
![[ ]](/icons/layout.gif) | databricks-alteryx-a-best-practices-guide-de.pdf | 2025-04-15 09:58 | 4.6M | |
![[ ]](/icons/layout.gif) | 71018Implementing_P2P_for_Short_Term_Success_and_Long_Term_Value.pdf | 2025-01-27 14:59 | 4.6M | |
![[ ]](/icons/layout.gif) | 151308_selectingtherighttrasnportationmanagementsystem.pdf | 2026-01-12 09:27 | 4.6M | |
![[ ]](/icons/layout.gif) | 1 Empowering Enterprises with AI Entering the Era of Choice.pdf | 2025-05-09 13:00 | 4.6M | |
![[ ]](/icons/layout.gif) | Asset - NeoLoad vs LoadRunner guide comparatif.pdf | 2025-11-26 10:20 | 4.6M | |
![[ ]](/icons/layout.gif) | 143864_Asset 1Definitiveguidetoenterprisebrowsers.pdf | 2025-01-27 14:39 | 4.7M | |
![[ ]](/icons/layout.gif) | 140393_definitiveguidetoenterprisebrowsers.pdf | 2024-12-27 17:06 | 4.7M | |
![[ ]](/icons/layout.gif) | 69832Datasheet.pdf | 2024-11-06 14:28 | 4.7M | |
![[ ]](/icons/layout.gif) | Analyzing the Economic Benefits of Moving from SAP ERP HCM to SAP SuccessFactors Solutions.pdf | 2025-03-12 13:55 | 4.7M | |
![[ ]](/icons/layout.gif) | 5-steps that accelerate AI-Driven productivity in your organization E.pdf | 2025-03-04 14:40 | 4.7M | |
![[ ]](/icons/layout.gif) | agentic-innovations-2026.pdf | 2026-03-20 08:31 | 4.7M | |
![[ ]](/icons/layout.gif) | 147272_LNVGTAP_Q1MB_Win11_TruScaleChklist_Intel.pdf | 2025-06-06 14:23 | 4.7M | |
![[ ]](/icons/layout.gif) | 151777_DisasterReadinessEmergencyResponse_eBook_3d.pdf | 2026-02-18 08:31 | 4.7M | |
![[ ]](/icons/layout.gif) | 73554Veeam_Data_Platform___SophosのMDR_マネージド検出および対応_.pdf | 2025-08-01 12:27 | 4.8M | |
![[ ]](/icons/layout.gif) | 10818_Datasheet AI (3755) (black bold)_ES(MX)-1.pdf | 2025-05-12 08:40 | 4.8M | |
![[ ]](/icons/layout.gif) | 150718_definitiveguidetoenterprisebrowsers.pdf | 2025-12-24 08:06 | 4.8M | |
![[ ]](/icons/layout.gif) | Easily access, support, and manage all your endpoints.pdf | 2025-04-01 12:33 | 4.8M | |
![[ ]](/icons/layout.gif) | 142881_LNVGTAP_Q3MB_Win11Migrate_SecurityChecklist.pdf | 2024-11-28 09:07 | 4.9M | |
![[ ]](/icons/layout.gif) | 2025 Thales Data Threat Report.pdf | 2025-12-05 12:28 | 5.0M | |
![[ ]](/icons/layout.gif) | 148277_Amazon_2025.pdf | 2025-08-13 16:12 | 5.1M | |
![[ ]](/icons/layout.gif) | 148588_youraiisonlyasgoodasyourdata.pdf | 2025-11-26 07:56 | 5.1M | |
![[ ]](/icons/layout.gif) | 5-steps-to-a-bulletproof-data-prep-strategy.pdf | 2025-04-16 09:19 | 5.2M | |
![[ ]](/icons/layout.gif) | FaaS ebook vF.pdf | 2025-01-14 11:11 | 5.2M | |
![[ ]](/icons/layout.gif) | 72291Connecting_Fragmented_Digital_Architecture.pdf | 2025-09-12 10:26 | 5.2M | |
![[ ]](/icons/layout.gif) | 143050_Detener los ataques de ciberseguridad en los servicios financieros (1)-compressed.pdf | 2025-04-23 13:17 | 5.3M | |
![[ ]](/icons/layout.gif) | 144545_Anatomy of a trusted workspace EN.pdf | 2025-02-11 08:08 | 5.3M | |
![[ ]](/icons/layout.gif) | 145388_Four_ways_modern_payment_systems_drive_growth.pdf | 2025-12-19 10:08 | 5.3M | |
![[ ]](/icons/layout.gif) | livre-blanc-reddit_compressed.pdf | 2025-11-03 16:39 | 5.3M | |
![[ ]](/icons/layout.gif) | 5_Strategies_to_Defend_Against_the_Growing_Risk_of_Ransomware___SentinelOne.pdf | 2025-04-11 12:50 | 5.3M | |
![[ ]](/icons/layout.gif) | Understanding Social Engineering Attacks and What to Do About Them.pdf | 2025-07-28 11:23 | 5.3M | |
![[ ]](/icons/layout.gif) | 144938_202306 SD WAN Whitepaper Digital Transformation.pdf | 2025-02-20 12:13 | 5.4M | |
![[ ]](/icons/layout.gif) | 70326Astoņi_faktori__kas_jāizvērtē_pirms_Body_kameru_iegādes.pdf | 2025-02-12 07:38 | 5.4M | |
![[ ]](/icons/layout.gif) | 144873_csecommercegrowthguide_special programs-compressed.pdf | 2025-06-06 10:30 | 5.4M | |
![[ ]](/icons/layout.gif) | 143885 Gaining_observability_in_cloud.pdf | 2025-02-13 07:41 | 5.5M | |
![[ ]](/icons/layout.gif) | Gaining_observability_in_cloud.pdf | 2025-01-28 09:18 | 5.5M | |
![[ ]](/icons/layout.gif) | CVLT_SPA_Protecting-Crown-Jewels-AD_v1.1.pdf | 2025-09-12 12:26 | 5.5M | |
![[ ]](/icons/layout.gif) | 145431_dellfutureofworkinteractivebrochure.pdf | 2025-04-04 14:54 | 5.5M | |
![[ ]](/icons/layout.gif) | 72646financial_services_ai_data_maturity_playbook_de.pdf | 2025-07-04 14:02 | 5.5M | |
![[ ]](/icons/layout.gif) | 142904_ADSK_ABM_1tofew_Govt infra owners_APJ_ebook.pdf.pdf | 2024-12-06 13:47 | 5.5M | |
![[ ]](/icons/layout.gif) | 131185_UL Solutions Walmart Hardlines and Softlines Suppliers eBook.pdf | 2025-01-02 09:43 | 5.6M | |
![[ ]](/icons/layout.gif) | 147088_drivingsustainablefinancingasia.pdf | 2025-10-28 13:30 | 5.6M | |
![[ ]](/icons/layout.gif) | 149206_Scaling_AI.pdf | 2026-02-20 10:31 | 5.6M | |
![[ ]](/icons/layout.gif) | 145853_Documento Di Sintesi Del Global Threat Report 2025 Di Crowdstrike.pdf | 2025-04-23 08:50 | 6.2M | |
![[ ]](/icons/layout.gif) | 74797_EN_US_CS_56__manufacturing_industry_guide_translate_data_insights__1_.pdf | 2025-11-18 11:50 | 6.2M | |
![[ ]](/icons/layout.gif) | 10818_Datasheet AI (3755) (black bold)_PT-BR.pdf | 2025-05-12 08:07 | 6.2M | |
![[ ]](/icons/layout.gif) | 144970_MuleSoft 2025 Connectivity Benchmark Report.pdf | 2025-04-16 11:44 | 6.2M | |
![[ ]](/icons/layout.gif) | 145848_CrowdStrike 2025 Global Threat Report_compressed.pdf | 2025-04-23 08:44 | 6.2M | |
![[ ]](/icons/layout.gif) | 73894360_degrees_of_healthcare_provider.pdf | 2025-10-01 15:44 | 6.3M | |
![[ ]](/icons/layout.gif) | The-CISO-Survival-Guide.pdf | 2025-07-29 14:23 | 6.4M | |
![[ ]](/icons/layout.gif) | 149570_Find out how travel businesses scale with cross border payments1009 (1).pdf | 2025-09-30 14:42 | 6.4M | |
![[ ]](/icons/layout.gif) | 149570_Find out how travel businesses scale with cross border payments1009.pdf | 2025-09-30 14:29 | 6.4M | |
![[ ]](/icons/layout.gif) | Why choose managed FaaS vF.pdf | 2025-01-16 16:52 | 6.4M | |
![[ ]](/icons/layout.gif) | 141932_burnoutinhealthcarestaff.pdf | 2024-12-30 16:06 | 6.4M | |
![[ ]](/icons/layout.gif) | 142017_LNVGTAP_Q3MB_DWS_AI_Brochure.pdf | 2024-11-06 09:57 | 6.5M | |
![[ ]](/icons/layout.gif) | 143536_BTP0071.pdf | 2025-01-24 08:40 | 6.6M | |
![[ ]](/icons/layout.gif) | 360_degrees_of_lifesciences_pharma_EN_US_CS_109___pharma_technology_playbook_2024.pdf | 2025-10-01 15:27 | 6.7M | |
![[ ]](/icons/layout.gif) | 143821_Stopper les cyberattaques dans le secteur des services financiers_compressed-compressed.pdf | 2025-04-23 12:51 | 6.7M | |
![[ ]](/icons/layout.gif) | 145036_The_Enterprise_Risk_Management_Buyers_Guide.pdf | 2025-02-28 12:41 | 6.7M | |
![[ ]](/icons/layout.gif) | _5-Critical-Steps-To-Improve-Your-Organizations-Cyber-Resilience-en.pdf | 2025-06-03 06:34 | 6.7M | |
![[ ]](/icons/layout.gif) | 147192_Optimize Your Supply Chain with RealTime Data Insights.pdf | 2025-06-09 05:48 | 6.7M | |
![[ ]](/icons/layout.gif) | 10-steps-to-microsoft-365-cyber-resilience.pdf | 2024-11-21 07:50 | 6.7M | |
![[ ]](/icons/layout.gif) | Gestion commerciale 3 failles cach_es qui freinent votre croissance.pdf | 2025-10-23 08:47 | 6.7M | |
![[ ]](/icons/layout.gif) | 1920x1080_document-ad_todays-standad_learn_us_eng_accenture-ebook.pdf | 2025-10-29 16:49 | 6.8M | |
![[ ]](/icons/layout.gif) | 147110_LNVMY_Q1MB_ContentSynd_TPX1CarbonG13_Solguide.pdf | 2025-09-09 12:56 | 6.8M | |
![[ ]](/icons/layout.gif) | 147432_Data_Spotlight_Report_Vol1FNL_250602.pdf | 2025-06-18 15:03 | 6.8M | |
![[ ]](/icons/layout.gif) | 72961CFOs_Thriving_in_Disruptive_Times___Mastering_Transformation_with_CCH_Tagetik.pdf | 2025-06-02 09:51 | 6.8M | |
![[ ]](/icons/layout.gif) | 138304_GC600_dataultguidetdm_eBook_FINAL1.pdf | 2025-01-16 07:57 | 6.8M | |
![[ ]](/icons/layout.gif) | 140731_fr_ca__GC600_dataultguidetdm_eBook_FINAL.pdf.pdf | 2025-01-16 09:05 | 6.9M | |
![[ ]](/icons/layout.gif) | 5 Tactics to Level Up Your InStore Game.pdf | 2025-06-24 09:46 | 6.9M | |
![[ ]](/icons/layout.gif) | 145347_Choosing Broadband for CostEffective Growth.pdf | 2025-03-17 10:09 | 7.1M | |
![[ ]](/icons/layout.gif) | 143735_CX0151e AI CX .pdf | 2025-01-24 09:35 | 7.1M | |
![[ ]](/icons/layout.gif) | 73334EDU_Ergo_Guide_EN.pdf | 2025-07-15 16:12 | 7.1M | |
![[ ]](/icons/layout.gif) | 142507_elasticastrategicguidetoputtingyourdatatowork.pdf | 2025-01-14 11:24 | 7.1M | |
![[ ]](/icons/layout.gif) | 143529_PANW_VPN_replacement_eBook_2024.01.08_final.pdf | 2025-01-28 07:58 | 7.3M | |
![[ ]](/icons/layout.gif) | 73630998_22146692pdf.pdf | 2025-11-12 11:34 | 7.3M | |
![[ ]](/icons/layout.gif) | 147959_PAL_Endpoint Buyers Guide_20250205_Finalko.pdf | 2025-07-23 11:02 | 7.3M | |
![[ ]](/icons/layout.gif) | 149280_TheNextWaveReport.pdf | 2025-09-30 17:17 | 7.3M | |
![[ ]](/icons/layout.gif) | 148587_ibmgenerativeaiassistantsthecomplete2024buyersguide.pdf | 2025-11-26 08:04 | 7.3M | |
![[ ]](/icons/layout.gif) | 147783_PAL_Endpoint Buyers Guide_20250205_Finalzhcn_Simplified chinese.pdf | 2025-07-23 10:57 | 7.4M | |
![[ ]](/icons/layout.gif) | 147784_PAL_Endpoint Buyers Guide_20250205_Finalzhtw_Traditonal Chinese.pdf | 2025-07-23 10:54 | 7.4M | |
![[ ]](/icons/layout.gif) | 143990_Priority Access and Preemption for Critical Infrastructure Communications_12.10.24.pdf | 2025-12-11 17:49 | 7.4M | |
![[ ]](/icons/layout.gif) | Procurement-Is-Navigating-A-Tech-Tsunami-And-Its-Upending-How-You-Work.pdf | 2025-08-25 18:02 | 7.4M | |
![[ ]](/icons/layout.gif) | 152705_GuideToIntelligentAgreementManagement_Updated Feb 26.pdf | 2026-03-04 15:47 | 7.4M | |
![[ ]](/icons/layout.gif) | Small and Midsize Organizations Modernize for Productivity and Security, While Embr.pdf | 2025-11-05 18:05 | 7.4M | |
![[ ]](/icons/layout.gif) | comprehensive-guide-to-security-operations.pdf | 2025-06-17 10:43 | 7.6M | |
![[ ]](/icons/layout.gif) | 143526_Intuit_GDC_MidMarket_eBook_AU_compressed (1).pdf | 2025-02-06 11:48 | 7.6M | |
![[ ]](/icons/layout.gif) | 143526_Intuit_GDC_MidMarket_eBook_AU_compressed.pdf | 2025-02-03 12:42 | 7.6M | |
![[ ]](/icons/layout.gif) | 71127Syft_Explorer_Unleashing_Mobile_Real_Time_Trace_Gas_Analysis.pdf | 2025-02-05 12:38 | 7.6M | |
![[ ]](/icons/layout.gif) | 139767_operationalizinggenerativeaistrategicguide.pdf | 2025-01-14 09:54 | 7.8M | |
![[ ]](/icons/layout.gif) | 138323_7 Essential Data Use Cases for Startups.pdf | 2025-01-08 13:16 | 7.9M | |
![[ ]](/icons/layout.gif) | 145345_InStore_Experiences_Playbook_IT.pdf | 2025-04-10 14:45 | 7.9M | |
![[ ]](/icons/layout.gif) | Spanish DFI_report_es-MX_Final.pdf | 2025-02-04 13:44 | 7.9M | |
![[ ]](/icons/layout.gif) | 712462025_Future_of_Customer_Data.pdf | 2025-02-19 11:30 | 7.9M | |
![[ ]](/icons/layout.gif) | 721952025_Future_of_Customer_Data.pdf | 2025-04-16 10:45 | 7.9M | |
![[ ]](/icons/layout.gif) | 73890EY_POS_Market_Report_fr.pdf | 2025-12-03 10:33 | 8.0M | |
![[ ]](/icons/layout.gif) | Steering the shift of innovation_TDM_eBook.pdf | 2025-07-23 10:37 | 8.0M | |
![[ ]](/icons/layout.gif) | 146911.pdf | 2025-06-06 09:57 | 8.1M | |
![[ ]](/icons/layout.gif) | 73900EY_POS_Market_Report_ES.pdf | 2025-12-03 09:39 | 8.1M | |
![[ ]](/icons/layout.gif) | DNS-DHCP-and-IP-Address-Management-Strategies.pdf | 2025-10-15 09:14 | 8.1M | |
![[ ]](/icons/layout.gif) | 151307_integratedbusinessplanningebook.pdf | 2026-01-12 09:24 | 8.1M | |
![[ ]](/icons/layout.gif) | 71715Apparel_IT.pdf | 2025-06-24 09:55 | 8.2M | |
![[ ]](/icons/layout.gif) | 73900Guide___Apparel_ES.pdf | 2025-12-03 10:04 | 8.2M | |
![[ ]](/icons/layout.gif) | 145356_el ajuste perfecto.pdf | 2025-04-10 15:35 | 8.2M | |
![[ ]](/icons/layout.gif) | google_cloud_ai_trends_11zon.pdf | 2025-08-21 14:58 | 8.2M | |
![[ ]](/icons/layout.gif) | 7-ways-automation-optimizes-supply-chain-decisions-de.pdf | 2025-04-15 10:35 | 8.2M | |
![[ ]](/icons/layout.gif) | 147797_eGuide _ Expand to US for KR KR_F.pdf | 2025-07-21 07:06 | 8.3M | |
![[ ]](/icons/layout.gif) | 149353_eGuide _ Expand to US for KR KR_F (1).pdf | 2025-09-30 15:44 | 8.3M | |
![[ ]](/icons/layout.gif) | OneAdvanced Desk-Free Worker Report 2025-compressed.pdf | 2025-07-02 10:13 | 8.3M | |
![[ ]](/icons/layout.gif) | 143525_Intuit_GDC_MidMarket_eBook_ROW_compressed.pdf | 2025-01-09 07:56 | 8.3M | |
![[ ]](/icons/layout.gif) | 148363_LP 2 AIAgentsHandbookGuidanceontheuseAgenticAIinPublicsectorHealthEbook (1).pdf | 2025-10-22 08:53 | 8.3M | |
![[ ]](/icons/layout.gif) | 145370_InStore_Experiences_Playbook_DE.pdf | 2025-04-10 13:35 | 8.4M | |
![[ ]](/icons/layout.gif) | 695648_Ways_to_Transform_Your_Supply_Chain.pdf | 2024-11-20 15:27 | 8.5M | |
![[ ]](/icons/layout.gif) | 152377_Bridging_the_Gap_from_BFCM_to_NRF.pdf | 2026-03-05 04:53 | 8.7M | |
![[ ]](/icons/layout.gif) | The AI Ready Enterprise_Nexon Custom Research - ADAPT5 (002).pdf | 2025-04-15 12:06 | 8.8M | |
![[ ]](/icons/layout.gif) | pfpt-de-tr-the-human-factor-social-engineering-vol1-compressed.pdf | 2025-07-18 10:56 | 8.9M | |
![[ ]](/icons/layout.gif) | 150672_3. PANWSOCEfficiencyEbook_v07.pdf | 2025-12-24 08:02 | 8.9M | |
![[ ]](/icons/layout.gif) | rh-executive-guide-to-navigating-disruptive-technologies-ebook-1475601-202410-en_3.pdf | 2025-12-09 10:09 | 8.9M | |
![[ ]](/icons/layout.gif) | 148700_Indexing_the_AI_economy_FR.pdf | 2025-12-19 09:13 | 8.9M | |
![[ ]](/icons/layout.gif) | Delivering trusted and secure AI.pdf | 2025-06-13 10:21 | 9.0M | |
![[ ]](/icons/layout.gif) | 143069_Epson_Projection_Deck_V3.pdf | 2026-01-12 08:06 | 9.0M | |
![[ ]](/icons/layout.gif) | Drive speed and scale with generative AIpowered workflows.pdf | 2025-10-06 12:22 | 9.3M | |
![[ ]](/icons/layout.gif) | 143421_Ninetailed Pets Deli Case Study.pdf | 2024-12-23 08:08 | 9.4M | |
![[ ]](/icons/layout.gif) | 150714_q32025globalinsurancemarketinsights.pdf | 2025-12-22 08:30 | 9.4M | |
![[ ]](/icons/layout.gif) | 143746_ISBN0131.pdf | 2025-01-24 09:28 | 9.6M | |
![[ ]](/icons/layout.gif) | 141615_thehiddencostsofintercompanyinefficiency.pdf | 2024-11-26 16:08 | 9.8M | |
![[ ]](/icons/layout.gif) | 73497TAC_945_002_GBL_EBK_Simulation_for_Energy_Transition.pdf | 2025-07-18 10:36 | 9.8M | |
![[ ]](/icons/layout.gif) | 149354_eGuide _ Expand to SEA for KR (1).pdf | 2025-09-30 15:59 | 9.9M | |
![[ ]](/icons/layout.gif) | state_of_sales_sixth_edition.pdf | 2024-11-15 17:24 | 10M | |
![[ ]](/icons/layout.gif) | 150931_lspsneedtoreimaginethesupplychainnetworkenterblueyonder.pdf | 2025-12-12 10:41 | 10M | |
![[ ]](/icons/layout.gif) | 142266_Threat Report Summary MITRE Engenuity.pdf | 2025-01-02 08:00 | 10M | |
![[ ]](/icons/layout.gif) | 142633_Realities of Maintaining asset (1).pdf | 2024-12-23 07:53 | 10M | |
![[ ]](/icons/layout.gif) | 142633_Realities of Maintaining asset.pdf | 2024-11-28 09:03 | 10M | |
![[ ]](/icons/layout.gif) | CPAE25_Day_1_Digital_Resilience.pdf | 2025-10-07 14:14 | 11M | |
![[ ]](/icons/layout.gif) | 149133_Updated HIPAA Compliance for Healthcare Marketers.pdf | 2025-12-19 09:38 | 11M | |
![[ ]](/icons/layout.gif) | SG5125 JL Annual HR Report FY23 v9.5 (1) (1).pdf | 2024-11-19 10:30 | 11M | |
![[ ]](/icons/layout.gif) | 147172_mittrxdatabricks_surveyreport_final_06nov2023.pdf | 2025-12-17 07:56 | 12M | |
![[ ]](/icons/layout.gif) | 145525_Adyen Embedded PDF .pdf | 2025-04-10 12:25 | 12M | |
![[ ]](/icons/layout.gif) | 74436A_CIOS_Guide_to_Navigating_the_Boardroom.pdf | 2025-12-11 12:41 | 12M | |
![[ ]](/icons/layout.gif) | Amplifying+Human+Potential+with+AI_compressed (2)_compressed.pdf | 2026-01-30 10:57 | 12M | |
![[ ]](/icons/layout.gif) | 144660_businessguidetoaseanandbeyonden.pdf | 2025-02-25 13:22 | 12M | |
![[ ]](/icons/layout.gif) | 145144_LNVGTAP_Q4MB_DWS_AI_eBook.pdf | 2025-03-27 12:17 | 13M | |
![[ ]](/icons/layout.gif) | 69831RR_series_five.pdf | 2024-11-06 14:21 | 13M | |
![[ ]](/icons/layout.gif) | 72137US_IDC_EV_Tech_Marketer_GenAI_ebook__1_The Tech Marketers Guide to GenAI.pdf | 2025-04-14 10:13 | 13M | |
![[ ]](/icons/layout.gif) | banking_service_playbook_sn.pdf | 2024-11-15 17:11 | 13M | |
![[ ]](/icons/layout.gif) | 141566_Shopify Managed Markets Report_EY ASSET.pdf | 2025-01-06 16:47 | 13M | |
![[ ]](/icons/layout.gif) | 69380Generative_AI_eBook_FR.pdf | 2024-11-13 08:46 | 14M | |
![[ ]](/icons/layout.gif) | 144969_ADSK_ABM_1tofew_Govt Infra Owners_APJ_Interactive PDF.pdf | 2025-02-25 14:22 | 14M | |
![[ ]](/icons/layout.gif) | 143048_Stoppen von CyberAngriffen im Finanzdienstleistungssektor 1 (1).pdf | 2025-04-14 07:17 | 14M | |
![[ ]](/icons/layout.gif) | SecurityAwarenessTraining_Brochure_SP.pdf.pdf | 2025-02-04 13:32 | 15M | |
![[ ]](/icons/layout.gif) | English Kaspersky-IR_Analyst_report_Final.pdf | 2025-02-04 13:52 | 15M | |
![[ ]](/icons/layout.gif) | 143754_ISBN0221 .pdf | 2025-01-24 09:42 | 16M | |
![[ ]](/icons/layout.gif) | 70929definitive_guide_to_onboarding_2024.pdf | 2025-01-29 09:42 | 16M | |
![[ ]](/icons/layout.gif) | The-Definitive-Guide-to-Onboarding.pdf | 2024-12-16 14:15 | 16M | |
![[ ]](/icons/layout.gif) | 142882_LNVGTAP_Q3MB_IntelAIPC_SolGuide 1 1.pdf | 2024-12-12 10:43 | 17M | |
![[ ]](/icons/layout.gif) | 150864_EBANXBeyondBorders2025 final.pdf | 2025-12-17 08:04 | 17M | |
![[ ]](/icons/layout.gif) | Is AI right for your HR organization_.pdf | 2025-03-12 13:58 | 17M | |
![[ ]](/icons/layout.gif) | 145321_Unified Commerce Shopify vs. BigCommerce.pdf | 2025-04-11 10:17 | 19M | |
![[ ]](/icons/layout.gif) | English Kaspersky_MDR_Report_Eng_Final.pdf | 2025-02-04 13:54 | 19M | |
![[ ]](/icons/layout.gif) | 73630998_22146692_DigitalTwin_GMA_E_guide.pdf | 2025-11-12 14:15 | 20M | |
![[ ]](/icons/layout.gif) | DigitalTwin_GMA_E_guide.pdf | 2025-11-12 11:33 | 20M | |
![[ ]](/icons/layout.gif) | 150760_bigbookofdatawarehousingandbiv11010925final.pdf | 2026-02-25 08:10 | 21M | |
![[ ]](/icons/layout.gif) | 140336_Launching Digital Telco Brands 2024 (1).pdf | 2024-11-08 10:51 | 22M | |
![[ ]](/icons/layout.gif) | 150775_mit_bringingbreakthroughdataintelligencetoindustries.pdf | 2026-03-24 07:20 | 22M | |
![[ ]](/icons/layout.gif) | 141416_54639788804_TFE_CaseStudyWGU_R6T5_jt.pdf | 2025-12-12 12:39 | 28M | |
![[ ]](/icons/layout.gif) | 142634_Seeing Around Corners asset.pdf | 2024-12-23 08:15 | 29M | |
![[ ]](/icons/layout.gif) | 70399.pdf | 2024-12-10 13:41 | 33M | |
![[ ]](/icons/layout.gif) | Amplifying+Human+Potential+with+AI.pdf | 2026-01-30 10:36 | 42M | |
![[ ]](/icons/layout.gif) | 142462_Ebook Digital Distribution US.pdf | 2025-01-02 07:54 | 82M | |
|